New Search

Item 41 of 59 (back to results)
Previous previous next Next

cetoleic acid
A docosenoic acid having a cis-double bond at position 11.


Current search:

01. Food Nutrient & Dietary Chemicals: Lipid components [ChEBI:18059] > Fatty acids [ChEBI:35366]
×

Select any link to see items in a related category.

more general categories    information about this item
01. Food Nutrient & Dietary Chemicals 
01. Food Nutrient & Dietary Chemicals
 Lipid components [ChEBI:18059] (86) 
 Fatty acids [ChEBI:35366] (59) 
 Monounsaturated fatty acids [ChEBI:25413] (22) 
 fatty acid 22:1 (docosenoic acid) [ChEBI:36031] (2) 
 fatty acid 22:1 n-11 cis (cetoleic acid) [ChEBI:32428] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 long-chain fatty acid [CHEBI:15904] (221) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
 straight-chain fatty acid [CHEBI:59202] (143) 
 docosenoic acid [CHEBI:36031] (2) 
 cetoleic acid [CHEBI:32428] (1)
ChEBI Compound Accession Identifier  [CHEBI:32428]
ChEBI Compound Description  A docosenoic acid having a cis-double bond at position 11.
ChEBI Compound Identification Number  32428
ChEBI InChI Value  InChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h11-12H,2-10,13-21H2,1H3,(H,23,24)/b12-11-
ChEBI InChIKey Value  KJDZDTDNIULJBE-QXMHVHEDSA-N
ChEBI Compound Name  cetoleic acid
ChEBI SMILES Value  CCCCCCCCCC\\C=C/CCCCCCCCCC(O)=O
ChEBI Substance ID  8147777
ChEBI URL  ChEBI:32428
ChemSpider ID  4445898
Ontomatica Chemical Accession Key (OnChAKey)  KJDZDTDNIULJBE_QXMHVHEDSA_N_000_000000
PubChem Compound ID  5282771