New Search

Item 2 of 3 (back to results)
Previous previous next Next

salaspermic acid
A hexacyclic triterpenoid that is D:A-friedooleanan-29-oic acid substituted by a hydroxy group at position 3 and an epoxy group across positions 3 and 24 (the (3beta,20alpha stereoisomer). Isolated from Salacia macrosperma and Tripterygium wilfordii, it exhibits anti-HIV activity.


Current search:

06. Name of Biological Source of Chemical: Plantae > Magnoliophyta > Magnoliopsida > Celastrales > Celastraceae > Tripterygium
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 salaspermic acid [CHEBI:66153] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antiviral agent [CHEBI:22587] (216) 
 anti-HIV agent [CHEBI:64946] (126) 
 anti-HIV-1 agent [CHEBI:64947] (79) 
 HIV-1 reverse transcriptase inhibitor [CHEBI:53756] (30) 
 salaspermic acid [CHEBI:66153] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Celastrales (20) 
 Celastraceae (20) 
 Tripterygium (3) 
 Tripterygium wilfordii (3)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 plant structure [PO:0009011] (1497) 
 multi-tissue plant structure [PO:0025496] (1114) 
 plant organ [PO:0009008] (970) 
 plant axis [PO:0025004] (691) 
 root [PO:0009005] (486)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 triterpenoid [CHEBI:36615] (228) 
 hexacyclic triterpenoid [CHEBI:70994] (27) 
 salaspermic acid [CHEBI:66153] (1)
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 triterpenoid [CHEBI:36615] (228) 
 hexacyclic triterpenoid [CHEBI:70994] (27) 
 salaspermic acid [CHEBI:66153] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 hexacyclic triterpenoid [CHEBI:70994] (27) 
 salaspermic acid [CHEBI:66153] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 hexacyclic triterpenoid [CHEBI:70994] (27) 
 salaspermic acid [CHEBI:66153] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 hexacyclic triterpenoid [CHEBI:70994] (27) 
 salaspermic acid [CHEBI:66153] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 salaspermic acid [CHEBI:66153] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 hexacyclic triterpenoid [CHEBI:70994] (27) 
 salaspermic acid [CHEBI:66153] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 salaspermic acid [CHEBI:66153] (1)
ChEBI Compound Accession Identifier  [CHEBI:66153]
ChEBI Compound Description  A hexacyclic triterpenoid that is D:A-friedooleanan-29-oic acid substituted by a hydroxy group at position 3 and an epoxy group across positions 3 and 24 (the (3beta,20alpha stereoisomer). Isolated from Salacia macrosperma and Tripterygium wilfordii, it exhibits anti-HIV activity.
ChEBI Compound Identification Number  66153
ChEBI InChI Value  InChI=1S/C30H48O4/c1-19-29-9-7-20-26(4,21(29)8-10-30(19,33)34-18-29)14-16-28(6)22-17-25(3,23(31)32)12-11-24(22,2)13-15-27(20,28)5/h19-22,33H,7-18H2,1-6H3,(H,31,32)/t19-,20+,21+,22-,24-,25-,26-,27-,28+,29+,30+/m1/s1
ChEBI InChIKey Value  ZXENWDWQTWYUGY-UUZWCOCASA-N
ChEBI Compound Name  salaspermic acid
ChEBI SMILES Value  [H][C@@]12CC[C@]3(O)OC[C@@]1(CC[C@@]1([H])[C@@]2(C)CC[C@@]2(C)[C@]4([H])C[C@@](C)(CC[C@]4(C)CC[C@]12C)C(O)=O)[C@H]3C
ChEBI Substance ID  160709756
ChEBI URL  ChEBI:66153
ChemSpider ID  23327152
Ontomatica Chemical Accession Key (OnChAKey)  ZXENWDWQTWYUGY_UUZWCOCASA_N_000_000000
PubChem Compound ID  44593364