Item 2 of 11 (back to results) previous next brasixanthone B A member of the class of pyranoxanthones that is 2H,6H-pyrano[3,2-b]xanthen-6-one substituted by hydroxy, geminal methyl and a prenyl group at positions 5, 8, 2 and 12 respectively. It is isolated from the stem bark of Calophyllum brasiliense and exhibits significant inhibitory activity against 12-O-tetradecanoylphorbol-13-acetate induced Epstein-Barr virus early antigen activation in Raji cells.

Current search: 06. Name of Biological Source of Chemical: Plantae > Magnoliophyta > Magnoliopsida > Malpighiales > Calophyllaceae > Calophyllum × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   brasixanthone B [CHEBI:65519] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   brasixanthone B [CHEBI:65519] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Malpighiales (287)   Calophyllaceae (28)   Calophyllum (11)   Calophyllum brasiliense (6) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   portion of plant tissue [PO:0009007] (272)   epidermis [PO:0005679] (134)   shoot epidermis [PO:0006035] (134)   shoot axis epidermis [PO:0000112] (134)   stem epidermis [PO:0025178] (134) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasixanthone B [CHEBI:65519] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasixanthone B [CHEBI:65519] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  oxacycle [CHEBI:38104] (2002)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  oxacycle [CHEBI:38104] (2002)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  oxacycle [CHEBI:38104] (2002)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasixanthone B [CHEBI:65519] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasixanthone B [CHEBI:65519] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasixanthone B [CHEBI:65519] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasixanthone B [CHEBI:65519] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasixanthone B [CHEBI:65519] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranoxanthones [CHEBI:71238] (4)   brasixanthone B [CHEBI:65519] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasixanthone B [CHEBI:65519] (1) ChEBI Compound Accession Identifier:   [CHEBI:65519] ChEBI Compound Description:   A member of the class of pyranoxanthones that is 2H,6H-pyrano[3,2-b]xanthen-6-one substituted by hydroxy, geminal methyl and a prenyl group at positions 5, 8, 2 and 12 respectively. It is isolated from the stem bark of Calophyllum brasiliense and exhibits significant inhibitory activity against 12-O-tetradecanoylphorbol-13-acetate induced Epstein-Barr virus early antigen activation in Raji cells. ChEBI Compound Identification Number:   65519 ChEBI InChI Value:   InChI=1S/C23H22O5/c1-12(2)5-7-15-21-14(9-10-23(3,4)28-21)19(25)18-20(26)16-11-13(24)6-8-17(16)27-22(15)18/h5-6,8-11,24-25H,7H2,1-4H3 ChEBI InChIKey Value:   BFPCRQCNDMJVOT-UHFFFAOYSA-N ChEBI Compound Name:   brasixanthone B ChEBI SMILES Value:   CC(C)=CCc1c2OC(C)(C)C=Cc2c(O)c2c1oc1ccc(O)cc1c2=O ChEBI Substance ID:   160644933 ChEBI URL:   ChEBI:65519 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   BFPCRQCNDMJVOT_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   10362269