more general categories |
information about this item |
|
01. Food Nutrient & Dietary Chemicals |
 |
 |
|
01. Food Nutrient & Dietary Chemicals |
|
|
|
|
|
sitosterol [ChEBI:27693] (1) |
|
 |
03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
 |
05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
 |
06. Name of Biological Source of Chemical |
 |
 |
|
06. Name of Biological Source of Chemical |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Eupatorium cannabinum subspecies asiaticum (21) |
|
|
|
|
|
|
|
|
Pisonia aculeata (29) |
|
|
|
|
|
|
|
|
Rubia yunnanensis (57) |
|
|
|
|
|
|
|
|
Neolitsea daibuensis (24) |
|
|
|
|
|
|
|
|
Breynia fruticosa (24) |
|
|
|
|
|
|
|
|
Ficus mucuso (19) |
|
|
|
|
|
|
|
|
Melia toosendan (21) |
|
|
|
|
|
Citrus hystrix (19) |
|
 |
07. Part of Biological Source of Chemical |
 |
 |
|
07. Part of Biological Source of Chemical |
|
|
|
|
|
exocarp [PO:0009085] (21) |
|
|
fruit [PO:0009001] (81) |
|
|
|
|
|
root [PO:0009005] (486) |
|
|
stem [PO:0009047] (170) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
|
sitosterol [CHEBI:27693] (1) |
|
|
|
|
|
sitosterol [CHEBI:27693] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:27693] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
27693 |
ChEBI InChI Value: |
InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
ChEBI InChIKey Value: |
KZJWDPNRJALLNS-VJSFXXLFSA-N |
ChEBI Compound Name: |
sitosterol |
ChEBI SMILES Value: |
[H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CC[C@@H](CC)C(C)C |
ChEBI Substance ID: |
57581402 |
ChEBI URL: |
ChEBI:27693 |
ChemSpider ID: |
NS |
Ontomatica Chemical Accession Key (OnChAKey): |
KZJWDPNRJALLNS_VJSFXXLFSA_N_000_000000 |
PubChem Compound ID: |
222284 |