Item 1 of 1 (back to results) nalidixic acid A monocarboxylic acid comprising 1,8-naphthyridin-4-one substituted by carboxylic acid, ethyl and methyl groups at positions 3, 1, and 7, respectively.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > DNA synthesis inhibitor [CHEBI:59517] > nalidixic acid [CHEBI:100147] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   DNA synthesis inhibitor [CHEBI:59517] (15)   nalidixic acid [CHEBI:100147] (1)  antimicrobial agent [CHEBI:33281] (927)   antibiotic [CHEBI:22582] (193)   nalidixic acid [CHEBI:100147] (1)  antibacterial agent [CHEBI:33282] (317)   antibacterial drug [CHEBI:36047] (177)   nalidixic acid [CHEBI:100147] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   1,8-naphthyridine derivative [CHEBI:73537] (3)   nalidixic acid [CHEBI:100147] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   nalidixic acid [CHEBI:100147] (1) ChEBI Compound Accession Identifier:   [CHEBI:100147] ChEBI Compound Description:   A monocarboxylic acid comprising 1,8-naphthyridin-4-one substituted by carboxylic acid, ethyl and methyl groups at positions 3, 1, and 7, respectively. ChEBI Compound Identification Number:   100147 ChEBI InChI Value:   InChI=1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17) ChEBI InChIKey Value:   MHWLWQUZZRMNGJ-UHFFFAOYSA-N ChEBI Compound Name:   nalidixic acid ChEBI SMILES Value:   CCn1cc(C(O)=O)c(=O)c2ccc(C)nc12 ChEBI Substance ID:   85307281 ChEBI URL:   ChEBI:100147 ChemSpider ID:   4268 Ontomatica Chemical Accession Key (OnChAKey):   MHWLWQUZZRMNGJ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   4421