Item 1 of 1 (back to results) sirtinol A benzamide obtained by formal condensation of the carboxy group of 2-{[(2-hydroxy-1-naphthyl)methylene]amino}benzoic acid with the amino group of 1-phenylethylamine.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > histone deacetylase inhibitor [CHEBI:61115] > sirtinol [CHEBI:73158] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   Sir2 inhibitor [CHEBI:71181] (2)   sirtinol [CHEBI:73158] (1)  histone deacetylase inhibitor [CHEBI:61115] (11)   sirtinol [CHEBI:73158] (1) 05. Industrial Uses  05. Industrial Uses  anti-inflammatory agent [CHEBI:67079] (79)   sirtinol [CHEBI:73158] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   sirtinol [CHEBI:73158] (1)  organonitrogen compound [CHEBI:35352] (6705)   imine [CHEBI:24783] (23)   aldimine [CHEBI:33271] (4)   sirtinol [CHEBI:73158] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   sirtinol [CHEBI:73158] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   sirtinol [CHEBI:73158] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   sirtinol [CHEBI:73158] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   imine [CHEBI:24783] (23)   aldimine [CHEBI:33271] (4)   sirtinol [CHEBI:73158] (1)  heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   imine [CHEBI:24783] (23)   aldimine [CHEBI:33271] (4)   sirtinol [CHEBI:73158] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   sirtinol [CHEBI:73158] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   sirtinol [CHEBI:73158] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  phenols [CHEBI:33853] (868)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  bicyclic compound [CHEBI:33636] (1511)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  phenols [CHEBI:33853] (868)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  phenols [CHEBI:33853] (868)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  phenols [CHEBI:33853] (868)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   hydroxynaphthalene [CHEBI:24727] (23)   naphthols [CHEBI:25392] (9)   sirtinol [CHEBI:73158] (1) ChEBI Compound Accession Identifier:   [CHEBI:73158] ChEBI Compound Description:   A benzamide obtained by formal condensation of the carboxy group of 2-{[(2-hydroxy-1-naphthyl)methylene]amino}benzoic acid with the amino group of 1-phenylethylamine. ChEBI Compound Identification Number:   73158 ChEBI InChI Value:   InChI=1S/C26H22N2O2/c1-18(19-9-3-2-4-10-19)28-26(30)22-13-7-8-14-24(22)27-17-23-21-12-6-5-11-20(21)15-16-25(23)29/h2-18,29H,1H3,(H,28,30) ChEBI InChIKey Value:   UXJFDYIHRJGPFS-UHFFFAOYSA-N ChEBI Compound Name:   sirtinol ChEBI SMILES Value:   [H]C(=Nc1ccccc1C(=O)NC(C)c1ccccc1)c1c(O)ccc2ccccc12 ChEBI Substance ID:   162169328 ChEBI URL:   ChEBI:73158 ChemSpider ID:   4653960 Ontomatica Chemical Accession Key (OnChAKey):   UXJFDYIHRJGPFS_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   5717148