Item 1 of 1 (back to results) fukanemarin B A hydroxycoumarin that is 4-hydroxycoumarin substituted by a methoxy group ar position 7 and a 1,2,6-trimethyl-7-(4-methyl-2-furyl)-hepta-2(E),5(E)-dienyl moiety at position 3. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO).

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > nitric oxide synthase inhibitor [CHEBI:61908] > fukanemarin B [CHEBI:65920] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   nitric oxide synthase inhibitor [CHEBI:61908] (36)   fukanemarin B [CHEBI:65920] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   fukanemarin B [CHEBI:65920] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Apiales (90)   Apiaceae (42)   Ferula (25)   Ferula fukanensis (12) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   plant axis [PO:0025004] (691)   root [PO:0009005] (486) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   fukanemarin B [CHEBI:65920] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   fukanemarin B [CHEBI:65920] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   sesquiterpenoid [CHEBI:26658] (209)   fukanemarin B [CHEBI:65920] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   sesquiterpenoid [CHEBI:26658] (209)   fukanemarin B [CHEBI:65920] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   fukanemarin B [CHEBI:65920] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  aromatic ether [CHEBI:35618] (353)   fukanemarin B [CHEBI:65920] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  aromatic ether [CHEBI:35618] (353)   fukanemarin B [CHEBI:65920] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  aromatic ether [CHEBI:35618] (353)   fukanemarin B [CHEBI:65920] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  furans [CHEBI:24129] (114)   fukanemarin B [CHEBI:65920] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   fukanemarin B [CHEBI:65920] (1)  aromatic ether [CHEBI:35618] (353)   fukanemarin B [CHEBI:65920] (1) ChEBI Compound Accession Identifier:   [CHEBI:65920] ChEBI Compound Description:   A hydroxycoumarin that is 4-hydroxycoumarin substituted by a methoxy group ar position 7 and a 1,2,6-trimethyl-7-(4-methyl-2-furyl)-hepta-2(E),5(E)-dienyl moiety at position 3. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO). ChEBI Compound Identification Number:   65920 ChEBI InChI Value:   InChI=1S/C25H28O5/c1-15(11-20-12-16(2)14-29-20)7-6-8-17(3)18(4)23-24(26)21-10-9-19(28-5)13-22(21)30-25(23)27/h7-10,12-14,18,26H,6,11H2,1-5H3/b15-7+,17-8+ ChEBI InChIKey Value:   BPQMZQHENRZFOK-GXZANXLRSA-N ChEBI Compound Name:   fukanemarin B ChEBI SMILES Value:   COc1ccc2c(O)c(C(C)C(\C)=C\C\C=C(/C)Cc3cc(C)co3)c(=O)oc2c1 ChEBI Substance ID:   160709490 ChEBI URL:   ChEBI:65920 ChemSpider ID:   28282188 Ontomatica Chemical Accession Key (OnChAKey):   BPQMZQHENRZFOK_GXZANXLRSA_N_000_000000 PubChem Compound ID:   54717251