Item 1 of 1 (back to results) fukanefuromarin B A furanocoumarin that is 2,3-dihydrofuro[3,2-c]coumarin substituted by a hydroxy group at position 7, methyl groups at positions 2 and 3 (relatively trans configuration) and a 4,8-dimethyl-4(E),7-nonadien-6-onyl moiety at position 2. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO).

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > nitric oxide synthase inhibitor [CHEBI:61908] > fukanefuromarin B [CHEBI:65922] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   nitric oxide synthase inhibitor [CHEBI:61908] (36)   fukanefuromarin B [CHEBI:65922] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   fukanefuromarin B [CHEBI:65922] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Apiales (90)   Apiaceae (42)   Ferula (25)   Ferula fukanensis (12) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   plant axis [PO:0025004] (691)   root [PO:0009005] (486) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   fukanefuromarin B [CHEBI:65922] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   fukanefuromarin B [CHEBI:65922] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   fukanefuromarin B [CHEBI:65922] (1)  oxacycle [CHEBI:38104] (2002)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   fukanefuromarin B [CHEBI:65922] (1)  oxacycle [CHEBI:38104] (2002)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   sesquiterpenoid [CHEBI:26658] (209)   fukanefuromarin B [CHEBI:65922] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   sesquiterpenoid [CHEBI:26658] (209)   fukanefuromarin B [CHEBI:65922] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   fukanefuromarin B [CHEBI:65922] (1)  oxacycle [CHEBI:38104] (2002)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   fukanefuromarin B [CHEBI:65922] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   fukanefuromarin B [CHEBI:65922] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   fukanefuromarin B [CHEBI:65922] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   fukanefuromarin B [CHEBI:65922] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   fukanefuromarin B [CHEBI:65922] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   fukanefuromarin B [CHEBI:65922] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin B [CHEBI:65922] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   fukanefuromarin B [CHEBI:65922] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   fukanefuromarin B [CHEBI:65922] (1) ChEBI Compound Accession Identifier:   [CHEBI:65922] ChEBI Compound Description:   A furanocoumarin that is 2,3-dihydrofuro[3,2-c]coumarin substituted by a hydroxy group at position 7, methyl groups at positions 2 and 3 (relatively trans configuration) and a 4,8-dimethyl-4(E),7-nonadien-6-onyl moiety at position 2. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO). ChEBI Compound Identification Number:   65922 ChEBI InChI Value:   InChI=1S/C24H28O5/c1-14(2)11-18(26)12-15(3)7-6-10-24(5)16(4)21-22(29-24)19-9-8-17(25)13-20(19)28-23(21)27/h8-9,11-13,16,25H,6-7,10H2,1-5H3/b15-12+/t16-,24-/m1/s1 ChEBI InChIKey Value:   NWTCYOAKBSTWBB-NDIQIQBTSA-N ChEBI Compound Name:   fukanefuromarin B ChEBI SMILES Value:   C[C@@H]1c2c(O[C@]1(C)CCC\C(C)=C\C(=O)C=C(C)C)c1ccc(O)cc1oc2=O ChEBI Substance ID:   160709561 ChEBI URL:   ChEBI:65922 ChemSpider ID:   8516165 Ontomatica Chemical Accession Key (OnChAKey):   NWTCYOAKBSTWBB_NDIQIQBTSA_N_000_000000 PubChem Compound ID:   10340706