Item 1 of 1 (back to results) futokadsurin B A lignan that is tetrahydrofuran substituted by methyl groups at positions 3 and 4, a 3,4-dimethoxyphenyl group at position 5 and a 1,3-benzodioxol-5-yl moiety at position 2 (the 2S,3R,4R,5R stereoisomer). Isolated from the aerial parts of Piper futokadsura, it exhibits inhibitory activity against production of nitric oxide (NO).

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > nitric oxide synthase inhibitor [CHEBI:61908] > futokadsurin B [CHEBI:65937] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   nitric oxide synthase inhibitor [CHEBI:61908] (36)   futokadsurin B [CHEBI:65937] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   futokadsurin B [CHEBI:65937] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Piperales (63)   Piperaceae (62)   Piper (62)   Piper futokadsura (3) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   futokadsurin B [CHEBI:65937] (1)  oxacycle [CHEBI:38104] (2002)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   futokadsurin B [CHEBI:65937] (1)  oxacycle [CHEBI:38104] (2002)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  oxacycle [CHEBI:38104] (2002)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   futokadsurin B [CHEBI:65937] (1)  oxacycle [CHEBI:38104] (2002)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  oxacycle [CHEBI:38104] (2002)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   futokadsurin B [CHEBI:65937] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   futokadsurin B [CHEBI:65937] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   futokadsurin B [CHEBI:65937] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   futokadsurin B [CHEBI:65937] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  oxacycle [CHEBI:38104] (2002)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   futokadsurin B [CHEBI:65937] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   futokadsurin B [CHEBI:65937] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  oxacycle [CHEBI:38104] (2002)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  oxacycle [CHEBI:38104] (2002)   oxolanes [CHEBI:26912] (352)   futokadsurin B [CHEBI:65937] (1)  benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodioxoles [CHEBI:38298] (21)   futokadsurin B [CHEBI:65937] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   futokadsurin B [CHEBI:65937] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   futokadsurin B [CHEBI:65937] (1) ChEBI Compound Accession Identifier:   [CHEBI:65937] ChEBI Compound Description:   A lignan that is tetrahydrofuran substituted by methyl groups at positions 3 and 4, a 3,4-dimethoxyphenyl group at position 5 and a 1,3-benzodioxol-5-yl moiety at position 2 (the 2S,3R,4R,5R stereoisomer). Isolated from the aerial parts of Piper futokadsura, it exhibits inhibitory activity against production of nitric oxide (NO). ChEBI Compound Identification Number:   65937 ChEBI InChI Value:   InChI=1S/C21H24O5/c1-12-13(2)21(15-6-8-17-19(10-15)25-11-24-17)26-20(12)14-5-7-16(22-3)18(9-14)23-4/h5-10,12-13,20-21H,11H2,1-4H3/t12-,13-,20-,21+/m1/s1 ChEBI InChIKey Value:   HSMDOSKNXLVXIP-JRWOZQDASA-N ChEBI Compound Name:   futokadsurin B ChEBI SMILES Value:   COc1ccc(cc1OC)[C@@H]1O[C@@H]([C@H](C)[C@H]1C)c1ccc2OCOc2c1 ChEBI Substance ID:   160709691 ChEBI URL:   ChEBI:65937 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   HSMDOSKNXLVXIP_JRWOZQDASA_N_000_000000 PubChem Compound ID:   9548905