Item 1 of 1 (back to results) gerfelin A member of the class of benzoic acids that is salicylic acid which is substituted at position 6 by a methyl group and at position 4 by a 2,3-dihydroxy-5-methylphenoxy group.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > geranylgeranyl diphosphate synthase inhibitor [CHEBI:64411] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   geranylgeranyl diphosphate synthase inhibitor [CHEBI:64411] (1)   gerfelin [CHEBI:64410] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   gerfelin [CHEBI:64410] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   gerfelin [CHEBI:64410] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   gerfelin [CHEBI:64410] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   gerfelin [CHEBI:64410] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   gerfelin [CHEBI:64410] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   gerfelin [CHEBI:64410] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   gerfelin [CHEBI:64410] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   gerfelin [CHEBI:64410] (1)  aromatic ether [CHEBI:35618] (353)   gerfelin [CHEBI:64410] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   gerfelin [CHEBI:64410] (1)  aromatic ether [CHEBI:35618] (353)   gerfelin [CHEBI:64410] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   gerfelin [CHEBI:64410] (1)  aromatic ether [CHEBI:35618] (353)   gerfelin [CHEBI:64410] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   gerfelin [CHEBI:64410] (1)  aromatic ether [CHEBI:35618] (353)   gerfelin [CHEBI:64410] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   gerfelin [CHEBI:64410] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   gerfelin [CHEBI:64410] (1) ChEBI Compound Accession Identifier:   [CHEBI:64410] ChEBI Compound Description:   A member of the class of benzoic acids that is salicylic acid which is substituted at position 6 by a methyl group and at position 4 by a 2,3-dihydroxy-5-methylphenoxy group. ChEBI Compound Identification Number:   64410 ChEBI InChI Value:   InChI=1S/C15H14O6/c1-7-3-11(17)14(18)12(4-7)21-9-5-8(2)13(15(19)20)10(16)6-9/h3-6,16-18H,1-2H3,(H,19,20) ChEBI InChIKey Value:   BGSIXQHNQUBHAX-UHFFFAOYSA-N ChEBI Compound Name:   gerfelin ChEBI SMILES Value:   Cc1cc(O)c(O)c(Oc2cc(C)c(C(O)=O)c(O)c2)c1 ChEBI Substance ID:   135668235 ChEBI URL:   ChEBI:64410 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   BGSIXQHNQUBHAX_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   10149453