New Search

Item 1 of 1 (back to results)

decatromicin B
A carbohydrate-containing antibiotic isolated from Actinomadura sp. MK73-NF4. It specifically inhibits the growth of gram-positive bacteria including multi-drug resistant strains such as Staphylococcus aureus MS9610 and menthicilin-resistant S.aureus (MRSA).


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > decatromicin B [CHEBI:65729]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 decatromicin B [CHEBI:65729] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antibacterial agent [CHEBI:33282] (317) 
 decatromicin B [CHEBI:65729] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Archaea, Cyanobacteria and Bacteria (302) 
 Eubacteria (239) 
 Firmicutes (214) 
 Actinobacteria (204) 
 Actinobacteridae (204) 
 Actinomycetales (204) 
 Thermomonosporaceae (2) 
 Actinomadura (2)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 unspecified structure [PO:0000004] (703)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 enol [CHEBI:33823] (52) 
 decatromicin B [CHEBI:65729] (1)
 hydrides [CHEBI:33692] (1374) 
 organic hydride [CHEBI:37175] (1178) 
 organic fundamental parent [CHEBI:33245] (1178) 
 heterocyclic organic fundamental parent [CHEBI:35552] (537) 
 mancude organic heterocyclic parent [CHEBI:35571] (481) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organic mancude parent [CHEBI:35573] (488) 
 mancude organic heterocyclic parent [CHEBI:35571] (481) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 decatromicin B [CHEBI:65729] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 decatromicin B [CHEBI:65729] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 decatromicin B [CHEBI:65729] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 enol [CHEBI:33823] (52) 
 decatromicin B [CHEBI:65729] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 carbohydrate-containing antibiotic [CHEBI:23007] (58) 
 decatromicin B [CHEBI:65729] (1)
 deoxy sugar derivative [CHEBI:63338] (46) 
 deoxyhexose derivative [CHEBI:63340] (38) 
 trideoxyhexose derivative [CHEBI:63349] (13) 
 decatromicin B [CHEBI:65729] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 carbohydrate-containing antibiotic [CHEBI:23007] (58) 
 decatromicin B [CHEBI:65729] (1)
 deoxy sugar derivative [CHEBI:63338] (46) 
 deoxyhexose derivative [CHEBI:63340] (38) 
 trideoxyhexose derivative [CHEBI:63349] (13) 
 decatromicin B [CHEBI:65729] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 organic fundamental parent [CHEBI:33245] (1178) 
 heterocyclic organic fundamental parent [CHEBI:35552] (537) 
 mancude organic heterocyclic parent [CHEBI:35571] (481) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organic mancude parent [CHEBI:35573] (488) 
 mancude organic heterocyclic parent [CHEBI:35571] (481) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 heteroarene [CHEBI:33833] (1648) 
 monocyclic heteroarene [CHEBI:38179] (375) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 decatromicin B [CHEBI:65729] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 carbohydrate-containing antibiotic [CHEBI:23007] (58) 
 decatromicin B [CHEBI:65729] (1)
 deoxy sugar derivative [CHEBI:63338] (46) 
 deoxyhexose derivative [CHEBI:63340] (38) 
 trideoxyhexose derivative [CHEBI:63349] (13) 
 decatromicin B [CHEBI:65729] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 enol [CHEBI:33823] (52) 
 decatromicin B [CHEBI:65729] (1)
 ester [CHEBI:35701] (3370) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 heteroarene [CHEBI:33833] (1648) 
 monocyclic heteroarene [CHEBI:38179] (375) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 monocyclic heteroarene [CHEBI:38179] (375) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 mancude ring [CHEBI:35568] (488) 
 organic mancude parent [CHEBI:35573] (488) 
 mancude organic heterocyclic parent [CHEBI:35571] (481) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 spiro compound [CHEBI:33599] (78) 
 oxaspiro compound [CHEBI:37948] (63) 
 decatromicin B [CHEBI:65729] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 monocyclic heteroarene [CHEBI:38179] (375) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 heteroarene [CHEBI:33833] (1648) 
 monocyclic heteroarene [CHEBI:38179] (375) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 monocyclic heteroarene [CHEBI:38179] (375) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 macrocycle [CHEBI:51026] (234) 
 decatromicin B [CHEBI:65729] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 heteroarene [CHEBI:33833] (1648) 
 monocyclic heteroarene [CHEBI:38179] (375) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 heteroarene [CHEBI:33833] (1648) 
 monocyclic heteroarene [CHEBI:38179] (375) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 monocyclic heteroarene [CHEBI:38179] (375) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 decatromicin B [CHEBI:65729] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 decatromicin B [CHEBI:65729] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 enol [CHEBI:33823] (52) 
 decatromicin B [CHEBI:65729] (1)
 hydrides [CHEBI:33692] (1374) 
 organic hydride [CHEBI:37175] (1178) 
 organic fundamental parent [CHEBI:33245] (1178) 
 heterocyclic organic fundamental parent [CHEBI:35552] (537) 
 mancude organic heterocyclic parent [CHEBI:35571] (481) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 organic mancude parent [CHEBI:35573] (488) 
 mancude organic heterocyclic parent [CHEBI:35571] (481) 
 mancude organic heteromonocyclic parent [CHEBI:35555] (392) 
 azole [CHEBI:68452] (357) 
 pyrroles [CHEBI:26455] (40) 
 decatromicin B [CHEBI:65729] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 decatromicin B [CHEBI:65729] (1)
ChEBI Compound Accession Identifier  [CHEBI:65729]
ChEBI Compound Description  A carbohydrate-containing antibiotic isolated from Actinomadura sp. MK73-NF4. It specifically inhibits the growth of gram-positive bacteria including multi-drug resistant strains such as Staphylococcus aureus MS9610 and menthicilin-resistant S.aureus (MRSA).
ChEBI Compound Identification Number  65729
ChEBI InChI Value  InChI=1S/C45H56Cl2N2O10/c1-7-25-20-45-39(52)34(42(56)59-45)38(51)44(8-2)26(12-10-9-11-22(3)19-43(45,6)21-28(25)41(54)55)14-15-27-29(44)16-13-23(4)37(27)58-33-18-31(50)35(24(5)57-33)49-40(53)36-30(46)17-32(47)48-36/h9-10,14-15,17,19,21,23-27,29,31,33,35,37,48,50,52H,7-8,11-13,16,18,20H2,1-6H3,(H,49,53)(H,54,55)/b10-9+,22-19+/t23-,24+,25-,26+,27-,29+,31-,33-,35+,37-,43-,44+,45+/m0/s1
ChEBI InChIKey Value  OKYWSSBYCHUWKT-ZJOLZETKSA-N
ChEBI Compound Name  decatromicin B
ChEBI SMILES Value  [H][C@]12C\C=C\C\C(C)=C\[C@@]3(C)C=C([C@@H](CC)C[C@]33OC(=O)C(C(=O)[C@@]1(CC)[C@]1([H])CC[C@H](C)[C@]([H])(O[C@H]4C[C@H](O)[C@H](NC(=O)c5[nH]c(Cl)cc5Cl)[C@@H](C)O4)[C@@]1([H])C=C2)=C3O)C(O)=O
ChEBI Substance ID  160645301
ChEBI URL  ChEBI:65729
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  OKYWSSBYCHUWKT_ZJOLZETKSA_N_000_000000
PubChem Compound ID  70678770