Item 1 of 1 (back to results) decatromicin B A carbohydrate-containing antibiotic isolated from Actinomadura sp. MK73-NF4. It specifically inhibits the growth of gram-positive bacteria including multi-drug resistant strains such as Staphylococcus aureus MS9610 and menthicilin-resistant S.aureus (MRSA).

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > decatromicin B [CHEBI:65729] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   decatromicin B [CHEBI:65729] (1)  antimicrobial agent [CHEBI:33281] (927)   antibacterial agent [CHEBI:33282] (317)   decatromicin B [CHEBI:65729] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Archaea, Cyanobacteria and Bacteria (302)   Eubacteria (239)   Firmicutes (214)   Actinobacteria (204)   Actinobacteridae (204)   Actinomycetales (204)   Thermomonosporaceae (2)   Actinomadura (2) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  organic hydroxy compound [CHEBI:33822] (3050)   enol [CHEBI:33823] (52)   decatromicin B [CHEBI:65729] (1)  hydrides [CHEBI:33692] (1374)   organic hydride [CHEBI:37175] (1178)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   decatromicin B [CHEBI:65729] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   decatromicin B [CHEBI:65729] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   decatromicin B [CHEBI:65729] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  organic hydroxy compound [CHEBI:33822] (3050)   enol [CHEBI:33823] (52)   decatromicin B [CHEBI:65729] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  carbohydrate derivative [CHEBI:63299] (2582)   carbohydrate-containing antibiotic [CHEBI:23007] (58)   decatromicin B [CHEBI:65729] (1)  deoxy sugar derivative [CHEBI:63338] (46)   deoxyhexose derivative [CHEBI:63340] (38)   trideoxyhexose derivative [CHEBI:63349] (13)   decatromicin B [CHEBI:65729] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  carbohydrate derivative [CHEBI:63299] (2582)   carbohydrate-containing antibiotic [CHEBI:23007] (58)   decatromicin B [CHEBI:65729] (1)  deoxy sugar derivative [CHEBI:63338] (46)   deoxyhexose derivative [CHEBI:63340] (38)   trideoxyhexose derivative [CHEBI:63349] (13)   decatromicin B [CHEBI:65729] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   decatromicin B [CHEBI:65729] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  carbohydrate derivative [CHEBI:63299] (2582)   carbohydrate-containing antibiotic [CHEBI:23007] (58)   decatromicin B [CHEBI:65729] (1)  deoxy sugar derivative [CHEBI:63338] (46)   deoxyhexose derivative [CHEBI:63340] (38)   trideoxyhexose derivative [CHEBI:63349] (13)   decatromicin B [CHEBI:65729] (1)  organic hydroxy compound [CHEBI:33822] (3050)   enol [CHEBI:33823] (52)   decatromicin B [CHEBI:65729] (1)  ester [CHEBI:35701] (3370)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  mancude ring [CHEBI:35568] (488)   organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   spiro compound [CHEBI:33599] (78)   oxaspiro compound [CHEBI:37948] (63)   decatromicin B [CHEBI:65729] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  macrocycle [CHEBI:51026] (234)   decatromicin B [CHEBI:65729] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   decatromicin B [CHEBI:65729] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   decatromicin B [CHEBI:65729] (1)  organic hydroxy compound [CHEBI:33822] (3050)   enol [CHEBI:33823] (52)   decatromicin B [CHEBI:65729] (1)  hydrides [CHEBI:33692] (1374)   organic hydride [CHEBI:37175] (1178)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   decatromicin B [CHEBI:65729] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   decatromicin B [CHEBI:65729] (1) ChEBI Compound Accession Identifier:   [CHEBI:65729] ChEBI Compound Description:   A carbohydrate-containing antibiotic isolated from Actinomadura sp. MK73-NF4. It specifically inhibits the growth of gram-positive bacteria including multi-drug resistant strains such as Staphylococcus aureus MS9610 and menthicilin-resistant S.aureus (MRSA). ChEBI Compound Identification Number:   65729 ChEBI InChI Value:   InChI=1S/C45H56Cl2N2O10/c1-7-25-20-45-39(52)34(42(56)59-45)38(51)44(8-2)26(12-10-9-11-22(3)19-43(45,6)21-28(25)41(54)55)14-15-27-29(44)16-13-23(4)37(27)58-33-18-31(50)35(24(5)57-33)49-40(53)36-30(46)17-32(47)48-36/h9-10,14-15,17,19,21,23-27,29,31,33,35,37,48,50,52H,7-8,11-13,16,18,20H2,1-6H3,(H,49,53)(H,54,55)/b10-9+,22-19+/t23-,24+,25-,26+,27-,29+,31-,33-,35+,37-,43-,44+,45+/m0/s1 ChEBI InChIKey Value:   OKYWSSBYCHUWKT-ZJOLZETKSA-N ChEBI Compound Name:   decatromicin B ChEBI SMILES Value:   [H][C@]12C\C=C\C\C(C)=C\[C@@]3(C)C=C([C@@H](CC)C[C@]33OC(=O)C(C(=O)[C@@]1(CC)[C@]1([H])CC[C@H](C)[C@]([H])(O[C@H]4C[C@H](O)[C@H](NC(=O)c5[nH]c(Cl)cc5Cl)[C@@H](C)O4)[C@@]1([H])C=C2)=C3O)C(O)=O ChEBI Substance ID:   160645301 ChEBI URL:   ChEBI:65729 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   OKYWSSBYCHUWKT_ZJOLZETKSA_N_000_000000 PubChem Compound ID:   70678770