Item 1 of 1 (back to results) 7'-O-demethylisocephaeline A pyridoisoquinoline consisting of (1'beta)-emetan substituted by hydroxy groups at positions 6' and 7' and methoxy groups at positions 10 and 11. It is isolated from Psychotria klugii and exhibits antileishmanial activity.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > 7'-O-demethylisocephaeline [CHEBI:65740] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  antimicrobial agent [CHEBI:33281] (927)   antimicrobial drug [CHEBI:36043] (169)   antiprotozoal drug [CHEBI:35820] (168)   antileishmanial agent [CHEBI:70868] (22)   7'-O-demethylisocephaeline [CHEBI:65740] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   isoquinoline alkaloid [CHEBI:24921] (120)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   isoquinoline alkaloid [CHEBI:24921] (120)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  aromatic ether [CHEBI:35618] (353)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  aromatic ether [CHEBI:35618] (353)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  aromatic ether [CHEBI:35618] (353)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  aromatic ether [CHEBI:35618] (353)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoisoquinoline [CHEBI:61692] (5)   7'-O-demethylisocephaeline [CHEBI:65740] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   7'-O-demethylisocephaeline [CHEBI:65740] (1) ChEBI Compound Accession Identifier:   [CHEBI:65740] ChEBI Compound Description:   A pyridoisoquinoline consisting of (1'beta)-emetan substituted by hydroxy groups at positions 6' and 7' and methoxy groups at positions 10 and 11. It is isolated from Psychotria klugii and exhibits antileishmanial activity. ChEBI Compound Identification Number:   65740 ChEBI InChI Value:   InChI=1S/C27H36N2O4/c1-4-16-15-29-8-6-18-12-26(32-2)27(33-3)14-21(18)23(29)10-19(16)9-22-20-13-25(31)24(30)11-17(20)5-7-28-22/h11-14,16,19,22-23,28,30-31H,4-10,15H2,1-3H3/t16-,19-,22-,23-/m0/s1 ChEBI InChIKey Value:   HGQNZTBYUKKJLH-CQOCVSQPSA-N ChEBI Compound Name:   7'-O-demethylisocephaeline ChEBI SMILES Value:   [H][C@]1(C[C@]2([H])NCCc3cc(O)c(O)cc23)C[C@]2([H])N(CCc3cc(OC)c(OC)cc23)C[C@@H]1CC ChEBI Substance ID:   160709549 ChEBI URL:   ChEBI:65740 ChemSpider ID:   9060170 Ontomatica Chemical Accession Key (OnChAKey):   HGQNZTBYUKKJLH_CQOCVSQPSA_N_000_000000 PubChem Compound ID:   10884902