Item 1 of 1 (back to results) eckstolonol A phlorotannin that is [1,4]benzodioxino[2,3-a]oxanthrene substituted by hydroxy groups at positions 1, 3, 6, 9 and 11. Isolated from the brown alga Ecklonia stolonifera, it exhibits radical scavenging activity.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > eckstolonol [CHEBI:65820] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   eckstolonol [CHEBI:65820] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   tannin [CHEBI:26848] (14)   phlorotannin [CHEBI:71222] (6)   eckstolonol [CHEBI:65820] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   tannin [CHEBI:26848] (14)   phlorotannin [CHEBI:71222] (6)   eckstolonol [CHEBI:65820] (1)  organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   eckstolonol [CHEBI:65820] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   eckstolonol [CHEBI:65820] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   eckstolonol [CHEBI:65820] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   eckstolonol [CHEBI:65820] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   eckstolonol [CHEBI:65820] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   tannin [CHEBI:26848] (14)   phlorotannin [CHEBI:71222] (6)   eckstolonol [CHEBI:65820] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   eckstolonol [CHEBI:65820] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   eckstolonol [CHEBI:65820] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   tannin [CHEBI:26848] (14)   phlorotannin [CHEBI:71222] (6)   eckstolonol [CHEBI:65820] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   eckstolonol [CHEBI:65820] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   tannin [CHEBI:26848] (14)   phlorotannin [CHEBI:71222] (6)   eckstolonol [CHEBI:65820] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   eckstolonol [CHEBI:65820] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   eckstolonol [CHEBI:65820] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   tannin [CHEBI:26848] (14)   phlorotannin [CHEBI:71222] (6)   eckstolonol [CHEBI:65820] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   eckstolonol [CHEBI:65820] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   eckstolonol [CHEBI:65820] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   eckstolonol [CHEBI:65820] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   eckstolonol [CHEBI:65820] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   eckstolonol [CHEBI:65820] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   tannin [CHEBI:26848] (14)   phlorotannin [CHEBI:71222] (6)   eckstolonol [CHEBI:65820] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   tannin [CHEBI:26848] (14)   phlorotannin [CHEBI:71222] (6)   eckstolonol [CHEBI:65820] (1) 09. Chemical Capabilities  09. Chemical Capabilities  antioxidant [CHEBI:22586] (199)   radical scavenger [CHEBI:48578] (62)   eckstolonol [CHEBI:65820] (1) ChEBI Compound Accession Identifier:   [CHEBI:65820] ChEBI Compound Description:   A phlorotannin that is [1,4]benzodioxino[2,3-a]oxanthrene substituted by hydroxy groups at positions 1, 3, 6, 9 and 11. Isolated from the brown alga Ecklonia stolonifera, it exhibits radical scavenging activity. ChEBI Compound Identification Number:   65820 ChEBI InChI Value:   InChI=1S/C18H10O9/c19-6-1-8(21)14-11(3-6)26-17-13(24-14)5-10(23)16-18(17)27-15-9(22)2-7(20)4-12(15)25-16/h1-5,19-23H ChEBI InChIKey Value:   LBHQACSAGWCMAB-UHFFFAOYSA-N ChEBI Compound Name:   eckstolonol ChEBI SMILES Value:   Oc1cc(O)c2oc3c(oc2c1)c(O)cc1oc2c(O)cc(O)cc2oc31 ChEBI Substance ID:   160709472 ChEBI URL:   ChEBI:65820 ChemSpider ID:   8604642 Ontomatica Chemical Accession Key (OnChAKey):   LBHQACSAGWCMAB_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   10429214