| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
gibberosin K [CHEBI:65960] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
gibberosin K [CHEBI:65960] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:65960] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
65960 |
| ChEBI InChI Value: |
InChI=1S/C20H30O2/c1-14-7-6-8-15(2)16-13-20(5,17(16)10-9-14)18(21)11-12-19(3,4)22/h7,11-12,16-17,22H,2,6,8-10,13H2,1,3-5H3/b12-11+,14-7+/t16-,17-,20-/m0/s1 |
| ChEBI InChIKey Value: |
HFOYWBKBWBSCMJ-CNEVOPABSA-N |
| ChEBI Compound Name: |
gibberosin K |
| ChEBI SMILES Value: |
[H][C@@]12C[C@](C)(C(=O)\C=C\C(C)(C)O)[C@@]1([H])CC\C(C)=C\CCC2=C |
| ChEBI Substance ID: |
160710002 |
| ChEBI URL: |
ChEBI:65960 |
| ChemSpider ID: |
23076670 |
| Ontomatica Chemical Accession Key (OnChAKey): |
HFOYWBKBWBSCMJ_CNEVOPABSA_N_000_000000 |
| PubChem Compound ID: |
23661416 |