Item 1 of 1 (back to results) juglanin B A cyclic ketone isolated from the extract of the seed husks of walnuts Juglans regia and has been shown to exhibit cytotoxic activity against human hepatoma cells.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > juglanin B [CHEBI:66127] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   juglanin B [CHEBI:66127] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   juglanin B [CHEBI:66127] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Fagales (25)   Juglandaceae (25)   Juglans (25)   Juglans regia (4) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   portion of plant tissue [PO:0009007] (272)   pericarp [PO:0009084] (3) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   juglanin B [CHEBI:66127] (1)  phenols [CHEBI:33853] (868)   juglanin B [CHEBI:66127] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   juglanin B [CHEBI:66127] (1)  phenols [CHEBI:33853] (868)   juglanin B [CHEBI:66127] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   juglanin B [CHEBI:66127] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   juglanin B [CHEBI:66127] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   juglanin B [CHEBI:66127] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   juglanin B [CHEBI:66127] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   juglanin B [CHEBI:66127] (1)  phenols [CHEBI:33853] (868)   juglanin B [CHEBI:66127] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   juglanin B [CHEBI:66127] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   juglanin B [CHEBI:66127] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   juglanin B [CHEBI:66127] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   juglanin B [CHEBI:66127] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   juglanin B [CHEBI:66127] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   juglanin B [CHEBI:66127] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   juglanin B [CHEBI:66127] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   juglanin B [CHEBI:66127] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   juglanin B [CHEBI:66127] (1)  phenols [CHEBI:33853] (868)   juglanin B [CHEBI:66127] (1) ChEBI Compound Accession Identifier:   [CHEBI:66127] ChEBI Compound Description:   A cyclic ketone isolated from the extract of the seed husks of walnuts Juglans regia and has been shown to exhibit cytotoxic activity against human hepatoma cells. ChEBI Compound Identification Number:   66127 ChEBI InChI Value:   InChI=1S/C20H24O4/c1-24-19-12-14-4-2-3-5-15(21)8-6-13-7-9-18(22)16(10-13)17(11-14)20(19)23/h7,9-12,15,21-23H,2-6,8H2,1H3/t15-/m0/s1 ChEBI InChIKey Value:   AVDQDLSGSIPLPN-HNNXBMFYSA-N ChEBI Compound Name:   juglanin B ChEBI SMILES Value:   COc1cc2CCCC[C@H](O)CCc3ccc(O)c(c3)-c(c2)c1O ChEBI Substance ID:   160710207 ChEBI URL:   ChEBI:66127 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   AVDQDLSGSIPLPN_HNNXBMFYSA_N_000_000000 PubChem Compound ID:   44155973