Item 1 of 1 (back to results) kweichowenol B A benzoate ester that is the diester obtained by the formal condensation of two molecules of benzoic acid with the hydroxymethyl group at position 1 and the hydroxy group at position 4 of 1-(hydroxymethyl)cyclohex-5-ene-1,2,3,4-tetrol the (1S,4R,5S,6S stereoisomer). Isolated from the leaves of Uvaria kweichowensis, it exhibits antitumour activity.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > kweichowenol B [CHEBI:66152] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   kweichowenol B [CHEBI:66152] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   kweichowenol B [CHEBI:66152] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   triol [CHEBI:27136] (79)   kweichowenol B [CHEBI:66152] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   triol [CHEBI:27136] (79)   kweichowenol B [CHEBI:66152] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   kweichowenol B [CHEBI:66152] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   kweichowenol B [CHEBI:66152] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   kweichowenol B [CHEBI:66152] (1)  organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   triol [CHEBI:27136] (79)   kweichowenol B [CHEBI:66152] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   kweichowenol B [CHEBI:66152] (1)  aromatic ester [CHEBI:62732] (94)   benzoate ester [CHEBI:36054] (83)   kweichowenol B [CHEBI:66152] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   kweichowenol B [CHEBI:66152] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   aromatic ester [CHEBI:62732] (94)   benzoate ester [CHEBI:36054] (83)   kweichowenol B [CHEBI:66152] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   kweichowenol B [CHEBI:66152] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   triol [CHEBI:27136] (79)   kweichowenol B [CHEBI:66152] (1) ChEBI Compound Accession Identifier:   [CHEBI:66152] ChEBI Compound Description:   A benzoate ester that is the diester obtained by the formal condensation of two molecules of benzoic acid with the hydroxymethyl group at position 1 and the hydroxy group at position 4 of 1-(hydroxymethyl)cyclohex-5-ene-1,2,3,4-tetrol the (1S,4R,5S,6S stereoisomer). Isolated from the leaves of Uvaria kweichowensis, it exhibits antitumour activity. ChEBI Compound Identification Number:   66152 ChEBI InChI Value:   InChI=1S/C21H20O7/c22-17-16(28-20(25)15-9-5-2-6-10-15)11-12-21(26,18(17)23)13-27-19(24)14-7-3-1-4-8-14/h1-12,16-18,22-23,26H,13H2/t16-,17+,18-,21+/m0/s1 ChEBI InChIKey Value:   PCFGXGDGOLIQTE-TWFHAPMSSA-N ChEBI Compound Name:   kweichowenol B ChEBI SMILES Value:   O[C@@H]1[C@@H](OC(=O)c2ccccc2)C=C[C@@](O)(COC(=O)c2ccccc2)[C@H]1O ChEBI Substance ID:   160710173 ChEBI URL:   ChEBI:66152 ChemSpider ID:   9524559 Ontomatica Chemical Accession Key (OnChAKey):   PCFGXGDGOLIQTE_TWFHAPMSSA_N_000_000000 PubChem Compound ID:   11349622