Item 1 of 1 (back to results) swertipunicoside "A C-glycosyl compound that is the 2'-C-beta-D-glucopyranosyl derivative of 1,5,8-trihydroxy-3-methoxy-7-(1',3',6',7'-tetrahydroxy-9'-oxo-4'-xanthyl)xanthone; isolated from Swertia punicea."

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > swertipunicoside [CHEBI:66538] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   swertipunicoside [CHEBI:66538] (1)  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   anti-HIV agent [CHEBI:64946] (126)   anti-HIV-1 agent [CHEBI:64947] (79)   HIV-1 reverse transcriptase inhibitor [CHEBI:53756] (30)   swertipunicoside [CHEBI:66538] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Gentianales (112)   Gentianaceae (15)   Swertia (15)   Swertia punicea (3) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   whole plant [PO:0000003] (150) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   swertipunicoside [CHEBI:66538] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   swertipunicoside [CHEBI:66538] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   swertipunicoside [CHEBI:66538] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   swertipunicoside [CHEBI:66538] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   swertipunicoside [CHEBI:66538] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   swertipunicoside [CHEBI:66538] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   swertipunicoside [CHEBI:66538] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   swertipunicoside [CHEBI:66538] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   swertipunicoside [CHEBI:66538] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   swertipunicoside [CHEBI:66538] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   swertipunicoside [CHEBI:66538] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   swertipunicoside [CHEBI:66538] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   swertipunicoside [CHEBI:66538] (1)  aromatic ether [CHEBI:35618] (353)   swertipunicoside [CHEBI:66538] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   swertipunicoside [CHEBI:66538] (1)  aromatic ether [CHEBI:35618] (353)   swertipunicoside [CHEBI:66538] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   swertipunicoside [CHEBI:66538] (1)  aromatic ether [CHEBI:35618] (353)   swertipunicoside [CHEBI:66538] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  ring assembly [CHEBI:36820] (165)   biaryl [CHEBI:64459] (79)   swertipunicoside [CHEBI:66538] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   swertipunicoside [CHEBI:66538] (1)  aromatic ether [CHEBI:35618] (353)   swertipunicoside [CHEBI:66538] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   swertipunicoside [CHEBI:66538] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   swertipunicoside [CHEBI:66538] (1) ChEBI Compound Accession Identifier:   [CHEBI:66538] ChEBI Compound Description:   "A C-glycosyl compound that is the 2'-C-beta-D-glucopyranosyl derivative of 1,5,8-trihydroxy-3-methoxy-7-(1',3',6',7'-tetrahydroxy-9'-oxo-4'-xanthyl)xanthone; isolated from Swertia punicea." ChEBI Compound Identification Number:   66538 ChEBI InChI Value:   InChI=1S/C33H26O17/c1-47-8-2-13(37)19-16(3-8)49-31-14(38)5-10(24(40)20(31)27(19)43)18-26(42)22(33-30(46)29(45)25(41)17(7-34)50-33)28(44)21-23(39)9-4-11(35)12(36)6-15(9)48-32(18)21/h2-6,17,25,29-30,33-38,40-42,44-46H,7H2,1H3/t17-,25-,29+,30-,33+/m1/s1 ChEBI InChIKey Value:   GNMLPEJAIRBAAO-FLJAPRSHSA-N ChEBI Compound Name:   swertipunicoside ChEBI SMILES Value:   COc1cc(O)c2c(c1)oc1c(O)cc(c(O)c1c2=O)-c1c(O)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c2c1oc1cc(O)c(O)cc1c2=O ChEBI Substance ID:   160709649 ChEBI URL:   ChEBI:66538 ChemSpider ID:   4479269 Ontomatica Chemical Accession Key (OnChAKey):   GNMLPEJAIRBAAO_FLJAPRSHSA_N_000_000000 PubChem Compound ID:   5321573