Item 1 of 1 (back to results) laccaridione B An organic heterotricyclic compound that is 1H-benzo[g]isochromene-8,9-dione substituted by an ethoxy group at position 1, hydroxy group at position 10, a methoxy group at position 7 and a 4-methylhex-2-en-2-yl group at position 3. Isolated from the stem of the fruiting bodies of the basidiomycete strain Laccaria amethystea, it exhibits inhibitory activity against proteases.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > laccaridione B [CHEBI:66541] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   protease inhibitor [CHEBI:37670] (37)   laccaridione B [CHEBI:66541] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   laccaridione B [CHEBI:66541] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   laccaridione B [CHEBI:66541] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   laccaridione B [CHEBI:66541] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   laccaridione B [CHEBI:66541] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   laccaridione B [CHEBI:66541] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   laccaridione B [CHEBI:66541] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   laccaridione B [CHEBI:66541] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   laccaridione B [CHEBI:66541] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   laccaridione B [CHEBI:66541] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   laccaridione B [CHEBI:66541] (1)  quinone [CHEBI:36141] (209)   laccaridione B [CHEBI:66541] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   laccaridione B [CHEBI:66541] (1)  aromatic ether [CHEBI:35618] (353)   laccaridione B [CHEBI:66541] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   laccaridione B [CHEBI:66541] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   laccaridione B [CHEBI:66541] (1)  aromatic ether [CHEBI:35618] (353)   laccaridione B [CHEBI:66541] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   laccaridione B [CHEBI:66541] (1)  aromatic ether [CHEBI:35618] (353)   laccaridione B [CHEBI:66541] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromenes [CHEBI:38761] (11)   laccaridione B [CHEBI:66541] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   laccaridione B [CHEBI:66541] (1)  aromatic ether [CHEBI:35618] (353)   laccaridione B [CHEBI:66541] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   laccaridione B [CHEBI:66541] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   laccaridione B [CHEBI:66541] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   laccaridione B [CHEBI:66541] (1) ChEBI Compound Accession Identifier:   [CHEBI:66541] ChEBI Compound Description:   An organic heterotricyclic compound that is 1H-benzo[g]isochromene-8,9-dione substituted by an ethoxy group at position 1, hydroxy group at position 10, a methoxy group at position 7 and a 4-methylhex-2-en-2-yl group at position 3. Isolated from the stem of the fruiting bodies of the basidiomycete strain Laccaria amethystea, it exhibits inhibitory activity against proteases. ChEBI Compound Identification Number:   66541 ChEBI InChI Value:   InChI=1S/C23H26O6/c1-6-12(3)8-13(4)16-10-15-9-14-11-17(27-5)20(24)22(26)18(14)21(25)19(15)23(29-16)28-7-2/h8-12,23,25H,6-7H2,1-5H3/b13-8+ ChEBI InChIKey Value:   UMMLLCGZZRNVRG-MDWZMJQESA-N ChEBI Compound Name:   laccaridione B ChEBI SMILES Value:   CCOC1OC(=Cc2cc3C=C(OC)C(=O)C(=O)c3c(O)c12)\C(C)=C\C(C)CC ChEBI Substance ID:   160709737 ChEBI URL:   ChEBI:66541 ChemSpider ID:   8106375 Ontomatica Chemical Accession Key (OnChAKey):   UMMLLCGZZRNVRG_MDWZMJQESA_N_000_000000 PubChem Compound ID:   9930744