Item 1 of 1 (back to results) laurolistine An isoquinoline alkaloid that is noraporphine substituted by hydroxy groups at positions 2 and 9 and methoxy groups at positions 1 and 10. Isolated from Litsea glutinosa and Lindera chunii, exhibits inhibitory activity against HIV-1 integrase.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > laurolistine [CHEBI:66557] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   laurolistine [CHEBI:66557] (1)  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   anti-HIV agent [CHEBI:64946] (126)   anti-HIV-1 agent [CHEBI:64947] (79)   HIV-1 integrase inhibitor [CHEBI:67268] (16)   laurolistine [CHEBI:66557] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   laurolistine [CHEBI:66557] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   isoquinoline alkaloid [CHEBI:24921] (120)   laurolistine [CHEBI:66557] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   laurolistine [CHEBI:66557] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   laurolistine [CHEBI:66557] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   laurolistine [CHEBI:66557] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   isoquinoline alkaloid [CHEBI:24921] (120)   laurolistine [CHEBI:66557] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   laurolistine [CHEBI:66557] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   laurolistine [CHEBI:66557] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   laurolistine [CHEBI:66557] (1)  aromatic ether [CHEBI:35618] (353)   laurolistine [CHEBI:66557] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   laurolistine [CHEBI:66557] (1)  aromatic ether [CHEBI:35618] (353)   laurolistine [CHEBI:66557] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   laurolistine [CHEBI:66557] (1)  aromatic ether [CHEBI:35618] (353)   laurolistine [CHEBI:66557] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   laurolistine [CHEBI:66557] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   laurolistine [CHEBI:66557] (1)  aromatic ether [CHEBI:35618] (353)   laurolistine [CHEBI:66557] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   laurolistine [CHEBI:66557] (1) ChEBI Compound Accession Identifier:   [CHEBI:66557] ChEBI Compound Description:   An isoquinoline alkaloid that is noraporphine substituted by hydroxy groups at positions 2 and 9 and methoxy groups at positions 1 and 10. Isolated from Litsea glutinosa and Lindera chunii, exhibits inhibitory activity against HIV-1 integrase. ChEBI Compound Identification Number:   66557 ChEBI InChI Value:   InChI=1S/C18H19NO4/c1-22-15-8-11-10(7-13(15)20)5-12-16-9(3-4-19-12)6-14(21)18(23-2)17(11)16/h6-8,12,19-21H,3-5H2,1-2H3/t12-/m0/s1 ChEBI InChIKey Value:   KYVJVURXKAZJRK-LBPRGKRZSA-N ChEBI Compound Name:   laurolistine ChEBI SMILES Value:   [H][C@@]12Cc3cc(O)c(OC)cc3-c3c(OC)c(O)cc(CCN1)c23 ChEBI Substance ID:   160709881 ChEBI URL:   ChEBI:66557 ChemSpider ID:   20821 Ontomatica Chemical Accession Key (OnChAKey):   KYVJVURXKAZJRK_LBPRGKRZSA_N_000_000000 PubChem Compound ID:   22179