Item 1 of 1 (back to results) lucidenic acid N A tetracyclic triterpenoid that is 25,26,27-trinorlanost-8-en-24-oic acid substituted by hydroxy groups at positions 3 and 7 and oxo groups at positions 11 and 15 respectively (the 3beta,5alpha,7beta stereoisomer). Isolated from the fruiting bodies of Ganoderma lucidum, it exhibits cytotoxicity against tumour cells.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > lucidenic acid N [CHEBI:66595] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   cholinesterase inhibitor [CHEBI:37733] (52)   lucidenic acid N [CHEBI:66595] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   lucidenic acid N [CHEBI:66595] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   lucidenic acid N [CHEBI:66595] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Fungi, Yeasts, Molds and Mildews (348)   Dikarya (97)   Basidiomycota (16)   Agaricomycotina (16)   Agaricomycetes (16)   Phallomycetidae (11)   Ganodermataceae (8)   Ganoderma (8)   Ganoderma lucidum (5) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   lucidenic acid N [CHEBI:66595] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   lucidenic acid N [CHEBI:66595] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  triterpenoid [CHEBI:36615] (228)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucidenic acid N [CHEBI:66595] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  triterpenoid [CHEBI:36615] (228)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucidenic acid N [CHEBI:66595] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   lucidenic acid N [CHEBI:66595] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucidenic acid N [CHEBI:66595] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   organic polycyclic compound [CHEBI:51958] (1654)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucidenic acid N [CHEBI:66595] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucidenic acid N [CHEBI:66595] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucidenic acid N [CHEBI:66595] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucidenic acid N [CHEBI:66595] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   lucidenic acid N [CHEBI:66595] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   lucidenic acid N [CHEBI:66595] (1) ChEBI Compound Accession Identifier:   [CHEBI:66595] ChEBI Compound Description:   A tetracyclic triterpenoid that is 25,26,27-trinorlanost-8-en-24-oic acid substituted by hydroxy groups at positions 3 and 7 and oxo groups at positions 11 and 15 respectively (the 3beta,5alpha,7beta stereoisomer). Isolated from the fruiting bodies of Ganoderma lucidum, it exhibits cytotoxicity against tumour cells. ChEBI Compound Identification Number:   66595 ChEBI InChI Value:   InChI=1S/C27H40O6/c1-14(7-8-21(32)33)15-11-20(31)27(6)23-16(28)12-18-24(2,3)19(30)9-10-25(18,4)22(23)17(29)13-26(15,27)5/h14-16,18-19,28,30H,7-13H2,1-6H3,(H,32,33)/t14-,15-,16+,18+,19+,25+,26-,27+/m1/s1 ChEBI InChIKey Value:   YBGBNHHXOJXFNM-UQCMLMITSA-N ChEBI Compound Name:   lucidenic acid N ChEBI SMILES Value:   [H][C@@]1(CC(=O)[C@@]2(C)C3=C(C(=O)C[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])C[C@@H]3O)[C@H](C)CCC(O)=O ChEBI Substance ID:   160710599 ChEBI URL:   ChEBI:66595 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   YBGBNHHXOJXFNM_UQCMLMITSA_N_000_000000 PubChem Compound ID:   21592283