Item 1 of 1 (back to results) luzonial B An iridoid monoterpenoid that is hexahydro-1H-cyclopenta[c]furan substituted by hydroxy groups at positions 1 and 3a, a 3-oxopropen-2yl group at position 6 and a cis-4-coumaroyloxy moiety at position 4 (the 1S,3aS,4S,6S,6aS stereoisomer). Isolated from the leaves of Viburnum luzonicum, it exhibits antineoplastic activity.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > luzonial B [CHEBI:66599] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   luzonial B [CHEBI:66599] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   luzonial B [CHEBI:66599] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   tertiary alcohol [CHEBI:26878] (183)   luzonial B [CHEBI:66599] (1)  secondary alcohol [CHEBI:35681] (342)   luzonial B [CHEBI:66599] (1)  phenols [CHEBI:33853] (868)   luzonial B [CHEBI:66599] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   tertiary alcohol [CHEBI:26878] (183)   luzonial B [CHEBI:66599] (1)  secondary alcohol [CHEBI:35681] (342)   luzonial B [CHEBI:66599] (1)  phenols [CHEBI:33853] (868)   luzonial B [CHEBI:66599] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   luzonial B [CHEBI:66599] (1)  carboxylic ester [CHEBI:33308] (1495)   alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68)   enoate ester [CHEBI:51702] (65)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   luzonial B [CHEBI:66599] (1)  carboxylic ester [CHEBI:33308] (1495)   alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68)   enoate ester [CHEBI:51702] (65)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   monoterpenoid [CHEBI:25409] (157)   iridoid monoterpenoid [CHEBI:50563] (6)   luzonial B [CHEBI:66599] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   monoterpenoid [CHEBI:25409] (157)   iridoid monoterpenoid [CHEBI:50563] (6)   luzonial B [CHEBI:66599] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   luzonial B [CHEBI:66599] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   luzonial B [CHEBI:66599] (1)  carboxylic ester [CHEBI:33308] (1495)   alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68)   enoate ester [CHEBI:51702] (65)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   tertiary alcohol [CHEBI:26878] (183)   luzonial B [CHEBI:66599] (1)  secondary alcohol [CHEBI:35681] (342)   luzonial B [CHEBI:66599] (1)  phenols [CHEBI:33853] (868)   luzonial B [CHEBI:66599] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68)   enoate ester [CHEBI:51702] (65)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   luzonial B [CHEBI:66599] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  phenols [CHEBI:33853] (868)   luzonial B [CHEBI:66599] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   luzonial B [CHEBI:66599] (1)  carboxylic ester [CHEBI:33308] (1495)   alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68)   enoate ester [CHEBI:51702] (65)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   luzonial B [CHEBI:66599] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   luzonial B [CHEBI:66599] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  phenols [CHEBI:33853] (868)   luzonial B [CHEBI:66599] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   luzonial B [CHEBI:66599] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  phenols [CHEBI:33853] (868)   luzonial B [CHEBI:66599] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   luzonial B [CHEBI:66599] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   luzonial B [CHEBI:66599] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   luzonial B [CHEBI:66599] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   luzonial B [CHEBI:66599] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   luzonial B [CHEBI:66599] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  phenols [CHEBI:33853] (868)   luzonial B [CHEBI:66599] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   luzonial B [CHEBI:66599] (1)  carboxylic ester [CHEBI:33308] (1495)   alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68)   enoate ester [CHEBI:51702] (65)   cinnamate ester [CHEBI:36087] (36)   luzonial B [CHEBI:66599] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   tertiary alcohol [CHEBI:26878] (183)   luzonial B [CHEBI:66599] (1)  secondary alcohol [CHEBI:35681] (342)   luzonial B [CHEBI:66599] (1)  phenols [CHEBI:33853] (868)   luzonial B [CHEBI:66599] (1) ChEBI Compound Accession Identifier:   [CHEBI:66599] ChEBI Compound Description:   An iridoid monoterpenoid that is hexahydro-1H-cyclopenta[c]furan substituted by hydroxy groups at positions 1 and 3a, a 3-oxopropen-2yl group at position 6 and a cis-4-coumaroyloxy moiety at position 4 (the 1S,3aS,4S,6S,6aS stereoisomer). Isolated from the leaves of Viburnum luzonicum, it exhibits antineoplastic activity. ChEBI Compound Identification Number:   66599 ChEBI InChI Value:   InChI=1S/C19H20O7/c1-11(9-20)14-8-15(19(24)10-25-18(23)17(14)19)26-16(22)7-4-12-2-5-13(21)6-3-12/h2-7,9,14-15,17-18,21,23-24H,1,8,10H2/b7-4-/t14-,15+,17-,18+,19+/m1/s1 ChEBI InChIKey Value:   HJTBDPQCVMXWMZ-FESMDYCJSA-N ChEBI Compound Name:   luzonial B ChEBI SMILES Value:   [H][C@@]12[C@@H](O)OC[C@]1(O)[C@H](C[C@@H]2C(=C)C=O)OC(=O)\C=C/c1ccc(O)cc1 ChEBI Substance ID:   160710335 ChEBI URL:   ChEBI:66599 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   HJTBDPQCVMXWMZ_FESMDYCJSA_N_000_000000 PubChem Compound ID:   9548910