Item 1 of 1 (back to results) phosphatoquinone B A naphthoquinone that is naphthalene-1,4-dione substituted by a (2E)-3,7-dimethylocta-2,6-dien-1-yl group at position 2, hydroxy groups at positions 5 and 7 and a methyl group at position 3. It is isolated from the culture broth of Streptomyces sp.TC-0363 and exhibits inhibitory activity against the enzyme protein tyrosine phosphatase.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > phosphatoquinone B [CHEBI:66752] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   protein tyrosine phosphatase inhibitor [CHEBI:35608] (3)   phosphatoquinone B [CHEBI:66752] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   phosphatoquinone B [CHEBI:66752] (1)  antimicrobial agent [CHEBI:33281] (927)   antibiotic [CHEBI:22582] (193)   phosphatoquinone B [CHEBI:66752] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Archaea, Cyanobacteria and Bacteria (302)   Eubacteria (239)   Firmicutes (214)   Actinobacteria (204)   Actinobacteridae (204)   Actinomycetales (204)   Streptomycetaceae (160)   Streptomyces (157) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   phosphatoquinone B [CHEBI:66752] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   phosphatoquinone B [CHEBI:66752] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   naphthoquinone [CHEBI:25481] (25)   phosphatoquinone B [CHEBI:66752] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   naphthoquinone [CHEBI:25481] (25)   phosphatoquinone B [CHEBI:66752] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   naphthoquinone [CHEBI:25481] (25)   phosphatoquinone B [CHEBI:66752] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   phosphatoquinone B [CHEBI:66752] (1)  quinone [CHEBI:36141] (209)   naphthoquinone [CHEBI:25481] (25)   phosphatoquinone B [CHEBI:66752] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   phosphatoquinone B [CHEBI:66752] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   naphthoquinone [CHEBI:25481] (25)   phosphatoquinone B [CHEBI:66752] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   phosphatoquinone B [CHEBI:66752] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   phosphatoquinone B [CHEBI:66752] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   phosphatoquinone B [CHEBI:66752] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   naphthoquinone [CHEBI:25481] (25)   phosphatoquinone B [CHEBI:66752] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   phosphatoquinone B [CHEBI:66752] (1) ChEBI Compound Accession Identifier:   [CHEBI:66752] ChEBI Compound Description:   A naphthoquinone that is naphthalene-1,4-dione substituted by a (2E)-3,7-dimethylocta-2,6-dien-1-yl group at position 2, hydroxy groups at positions 5 and 7 and a methyl group at position 3. It is isolated from the culture broth of Streptomyces sp.TC-0363 and exhibits inhibitory activity against the enzyme protein tyrosine phosphatase. ChEBI Compound Identification Number:   66752 ChEBI InChI Value:   InChI=1S/C21H24O4/c1-12(2)6-5-7-13(3)8-9-16-14(4)20(24)19-17(21(16)25)10-15(22)11-18(19)23/h6,8,10-11,22-23H,5,7,9H2,1-4H3/b13-8+ ChEBI InChIKey Value:   HFMUGRCEDVYMSK-MDWZMJQESA-N ChEBI Compound Name:   phosphatoquinone B ChEBI SMILES Value:   CC(C)=CCC\C(C)=C\CC1=C(C)C(=O)c2c(O)cc(O)cc2C1=O ChEBI Substance ID:   160645634 ChEBI URL:   ChEBI:66752 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   HFMUGRCEDVYMSK_MDWZMJQESA_N_000_000000 PubChem Compound ID:   9905947