Item 1 of 1 (back to results) onosmin B A benzoate ester obtained by the fromal condensation of the carboxy group of onosmin A with methanol. Isolated from Onosma hispida, it exhibits inhibitory activity against lipoxygenase.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > onosmin B [CHEBI:66822] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   lipoxygenase inhibitor [CHEBI:35856] (23)   onosmin B [CHEBI:66822] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   onosmin B [CHEBI:66822] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   onosmin B [CHEBI:66822] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   onosmin B [CHEBI:66822] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   onosmin B [CHEBI:66822] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   onosmin B [CHEBI:66822] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   onosmin B [CHEBI:66822] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   onosmin B [CHEBI:66822] (1)  aromatic ester [CHEBI:62732] (94)   benzoate ester [CHEBI:36054] (83)   onosmin B [CHEBI:66822] (1)  organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   onosmin B [CHEBI:66822] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   onosmin B [CHEBI:66822] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   aromatic ester [CHEBI:62732] (94)   benzoate ester [CHEBI:36054] (83)   onosmin B [CHEBI:66822] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   benzoate ester [CHEBI:36054] (83)   onosmin B [CHEBI:66822] (1) ChEBI Compound Accession Identifier:   [CHEBI:66822] ChEBI Compound Description:   A benzoate ester obtained by the fromal condensation of the carboxy group of onosmin A with methanol. Isolated from Onosma hispida, it exhibits inhibitory activity against lipoxygenase. ChEBI Compound Identification Number:   66822 ChEBI InChI Value:   InChI=1S/C16H17NO2/c1-12-7-9-13(10-8-12)11-17-15-6-4-3-5-14(15)16(18)19-2/h3-10,17H,11H2,1-2H3 ChEBI InChIKey Value:   YBTJTIATNGZKEJ-UHFFFAOYSA-N ChEBI Compound Name:   onosmin B ChEBI SMILES Value:   COC(=O)c1ccccc1NCc1ccc(C)cc1 ChEBI Substance ID:   160710410 ChEBI URL:   ChEBI:66822 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   YBTJTIATNGZKEJ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   11334308