Item 1 of 1 (back to results) glucoheptonic acid A carbohydrate acid that is heptanoic acid substituted by hydroxy groups at C-2, C-3, C-4, C-5, C-6, and C-7.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > glucoheptonic acid [CHEBI:67270] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   glucoheptonic acid [CHEBI:67270] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  organooxygen compound [CHEBI:36963] (11352)   carbohydrate [CHEBI:16646] (742)   carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbohydrate [CHEBI:16646] (742)   carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbohydrate [CHEBI:16646] (742)   carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   glucoheptonic acid [CHEBI:67270] (1)  carbohydrate acid [CHEBI:33720] (102)   glucoheptonic acid [CHEBI:67270] (1) ChEBI Compound Accession Identifier:   [CHEBI:67270] ChEBI Compound Description:   A carbohydrate acid that is heptanoic acid substituted by hydroxy groups at C-2, C-3, C-4, C-5, C-6, and C-7. ChEBI Compound Identification Number:   67270 ChEBI InChI Value:   InChI=1S/C7H14O8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h2-6,8-13H,1H2,(H,14,15)/t2-,3-,4+,5-,6-/m1/s1 ChEBI InChIKey Value:   KWMLJOLKUYYJFJ-VFUOTHLCSA-N ChEBI Compound Name:   glucoheptonic acid ChEBI SMILES Value:   OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(O)=O ChEBI Substance ID:   162012113 ChEBI URL:   ChEBI:67270 ChemSpider ID:   23854 Ontomatica Chemical Accession Key (OnChAKey):   KWMLJOLKUYYJFJ_VFUOTHLCSA_N_000_000000 PubChem Compound ID:   25588