Item 1 of 1 (back to results) 1-deoxypentalenic acid A tricyclic sesquiterpenoid that is pentalenene in which the 13-methyl group is oxidsed to the carboxylic acid.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > 1-deoxypentalenic acid [CHEBI:68832] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   1-deoxypentalenic acid [CHEBI:68832] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   sesquiterpenoid [CHEBI:26658] (209)   1-deoxypentalenic acid [CHEBI:68832] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   sesquiterpenoid [CHEBI:26658] (209)   1-deoxypentalenic acid [CHEBI:68832] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   1-deoxypentalenic acid [CHEBI:68832] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   1-deoxypentalenic acid [CHEBI:68832] (1) ChEBI Compound Accession Identifier:   [CHEBI:68832] ChEBI Compound Description:   A tricyclic sesquiterpenoid that is pentalenene in which the 13-methyl group is oxidsed to the carboxylic acid. ChEBI Compound Identification Number:   68832 ChEBI InChI Value:   InChI=1S/C15H22O2/c1-9-4-5-12-11(13(16)17)6-10-7-14(2,3)8-15(9,10)12/h6,9-10,12H,4-5,7-8H2,1-3H3,(H,16,17)/t9-,10-,12+,15-/m1/s1 ChEBI InChIKey Value:   DCFDRCCHOOORSB-DSKWVYQCSA-N ChEBI Compound Name:   1-deoxypentalenic acid ChEBI SMILES Value:   [H][C@@]12CC(C)(C)C[C@@]11[C@H](C)CC[C@@]1([H])C(=C2)C(O)=O ChEBI Substance ID:   160645944 ChEBI URL:   ChEBI:68832 ChemSpider ID:   9163397 Ontomatica Chemical Accession Key (OnChAKey):   DCFDRCCHOOORSB_DSKWVYQCSA_N_000_000000 PubChem Compound ID:   10988200