| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentalenolactone E [CHEBI:70807] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:70807] |
| ChEBI Compound Description: |
A sesquiterpene lactone obtained by formal dehydrogenation of the 4-methyl position of pentalenolactone D. |
| ChEBI Compound Identification Number: |
70807 |
| ChEBI InChI Value: |
InChI=1S/C15H18O4/c1-8-13(18)19-6-11-10(12(16)17)4-9-5-14(2,3)7-15(8,9)11/h4,9,11H,1,5-7H2,2-3H3,(H,16,17)/t9-,11+,15-/m1/s1 |
| ChEBI InChIKey Value: |
VDWJABPVVAYLBS-BPYAMOTFSA-N |
| ChEBI Compound Name: |
pentalenolactone E |
| ChEBI SMILES Value: |
[H][C@@]12CC(C)(C)C[C@@]11C(=C)C(=O)OC[C@@]1([H])C(=C2)C(O)=O |
| ChEBI Substance ID: |
160645975 |
| ChEBI URL: |
ChEBI:70807 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
VDWJABPVVAYLBS_BPYAMOTFSA_N_000_000000 |
| PubChem Compound ID: |
11054473 |