| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pyrrole-3,4-dicarboxylic acid [CHEBI:71162] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:71162] |
| ChEBI Compound Description: |
A pyrroledicarboxylic acid in which the two carboxy groups are located at positions 3 and 4. |
| ChEBI Compound Identification Number: |
71162 |
| ChEBI InChI Value: |
InChI=1S/C6H5NO4/c8-5(9)3-1-7-2-4(3)6(10)11/h1-2,7H,(H,8,9)(H,10,11) |
| ChEBI InChIKey Value: |
JFVDNCRMBALUKH-UHFFFAOYSA-N |
| ChEBI Compound Name: |
pyrrole-3,4-dicarboxylic acid |
| ChEBI SMILES Value: |
OC(=O)c1c[nH]cc1C(O)=O |
| ChEBI Substance ID: |
160655851 |
| ChEBI URL: |
ChEBI:71162 |
| ChemSpider ID: |
321206 |
| Ontomatica Chemical Accession Key (OnChAKey): |
JFVDNCRMBALUKH_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
361843 |