Item 1 of 1 (back to results) versiconol acetate An acetate ester that is the O-acetyl derivative of versiconol. An intermediate in the biosynthesis of aflatoxin.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > versiconol acetate [CHEBI:71657] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   versiconol acetate [CHEBI:71657] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versiconol acetate [CHEBI:71657] (2)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versiconol acetate [CHEBI:71657] (2)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   versiconol acetate [CHEBI:71657] (2)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   versiconol acetate [CHEBI:71657] (2)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   versiconol acetate [CHEBI:71657] (2)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versiconol acetate [CHEBI:71657] (2)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   versiconol acetate [CHEBI:71657] (2)  quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versiconol acetate [CHEBI:71657] (2)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   versiconol acetate [CHEBI:71657] (2)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versiconol acetate [CHEBI:71657] (2)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versiconol acetate [CHEBI:71657] (2)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versiconol acetate [CHEBI:71657] (2)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   versiconol acetate [CHEBI:71657] (2)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   versiconol acetate [CHEBI:71657] (2)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versiconol acetate [CHEBI:71657] (2) ChEBI Compound Accession Identifier:   [CHEBI:71657] ChEBI Compound Description:   An acetate ester that is the O-acetyl derivative of versiconol. An intermediate in the biosynthesis of aflatoxin. ChEBI Compound Identification Number:   71657 ChEBI InChI Value:   InChI=1S/C20H18O9/c1-8(22)29-3-2-9(7-21)15-14(25)6-12-17(19(15)27)20(28)16-11(18(12)26)4-10(23)5-13(16)24/h4-6,9,21,23-25,27H,2-3,7H2,1H3 ChEBI InChIKey Value:   BWYUKBCRHDFWFF-UHFFFAOYSA-N ChEBI Compound Name:   versiconol acetate ChEBI SMILES Value:   CC(=O)OCCC(CO)c1c(O)cc2C(=O)c3cc(O)cc(O)c3C(=O)c2c1O ChEBI Substance ID:   160713595 ChEBI URL:   ChEBI:71657 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   BWYUKBCRHDFWFF_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   51221