New Search

Item 1 of 1 (back to results)

halistanol sulfonic acid G
A steroid sulfate that is 5alpha-ergostane substituted by sulfate groups at positions 2, 3 and 6 (the (2beta,3alpha,6alpha stereoisomer).


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > halistanol sulfonic acid G [CHEBI:72479]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antiviral agent [CHEBI:22587] (216) 
 anti-HIV agent [CHEBI:64946] (126) 
 anti-HIV-1 agent [CHEBI:64947] (79) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 anti-HIV-2 agent [CHEBI:64949] (6) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic sulfate [CHEBI:25704] (169) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfuric acid derivative [CHEBI:37826] (219) 
 organic sulfate [CHEBI:25704] (169) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 sulfuric ester [CHEBI:26819] (161) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 sulfates [CHEBI:26820] (212) 
 organic sulfate [CHEBI:25704] (169) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic sulfate [CHEBI:25704] (169) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 steroid [CHEBI:35341] (716) 
 steroid ester [CHEBI:47880] (77) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic sulfate [CHEBI:25704] (169) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 ester [CHEBI:35701] (3370) 
 sulfuric ester [CHEBI:26819] (161) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 steroid ester [CHEBI:47880] (77) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 steroid [CHEBI:35341] (716) 
 steroid ester [CHEBI:47880] (77) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 steroid [CHEBI:35341] (716) 
 steroid ester [CHEBI:47880] (77) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 steroid [CHEBI:35341] (716) 
 steroid ester [CHEBI:47880] (77) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 steroid [CHEBI:35341] (716) 
 steroid ester [CHEBI:47880] (77) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 oxoacid derivative [CHEBI:33241] (3254) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfuric acid derivative [CHEBI:37826] (219) 
 organic sulfate [CHEBI:25704] (169) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 sulfuric ester [CHEBI:26819] (161) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
 sulfates [CHEBI:26820] (212) 
 organic sulfate [CHEBI:25704] (169) 
 steroid sulfate [CHEBI:16158] (18) 
 halistanol sulfonic acid G [CHEBI:72479] (1)
ChEBI Compound Accession Identifier  [CHEBI:72479]
ChEBI Compound Description  A steroid sulfate that is 5alpha-ergostane substituted by sulfate groups at positions 2, 3 and 6 (the (2beta,3alpha,6alpha stereoisomer).
ChEBI Compound Identification Number  72479
ChEBI InChI Value  InChI=1S/C28H50O12S3/c1-16(2)17(3)7-8-18(4)20-9-10-21-19-13-24(38-41(29,30)31)23-14-25(39-42(32,33)34)26(40-43(35,36)37)15-28(23,6)22(19)11-12-27(20,21)5/h16-26H,7-15H2,1-6H3,(H,29,30,31)(H,32,33,34)(H,35,36,37)/t17-,18+,19-,20+,21-,22-,23+,24-,25-,26-,27+,28+/m0/s1
ChEBI InChIKey Value  WBHAMVHLRVKJRH-VZAWWNCJSA-N
ChEBI Compound Name  halistanol sulfonic acid G
ChEBI SMILES Value  [H][C@@]1(CC[C@@]2([H])[C@]3([H])C[C@H](OS(O)(=O)=O)[C@@]4([H])C[C@H](OS(O)(=O)=O)[C@H](C[C@]4(C)[C@@]3([H])CC[C@]12C)OS(O)(=O)=O)[C@H](C)CC[C@H](C)C(C)C
ChEBI Substance ID  160962957
ChEBI URL  ChEBI:72479
ChemSpider ID  23339577
Ontomatica Chemical Accession Key (OnChAKey)  WBHAMVHLRVKJRH_VZAWWNCJSA_N_000_000000
PubChem Compound ID  44566799