Item 1 of 1 (back to results) versicolorin B An organic heteropentacyclic compound that is 2,3,3a,12a-tetrahydroanthra[2,3-b]furo[3,2-d]furan-5,10-dione carrying three hydroxy substituents at positions 4, 6 and 8.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > versicolorin B [CHEBI:72674] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   versicolorin B [CHEBI:72674] (1) 04. Bioactive Capabilities of Specific Chemicals   04. Bioactive Capabilities of Specific Chemicals  Lyases [EC:4] (743)   Carbon-oxygen lyases [EC:4.2] (393)   Hydro-Lyases [EC:4.2.1] (219)   Versicolorin B synthase [EC:4.2.1.143] (3)   versicolorin B [CHEBI:72674] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versicolorin B [CHEBI:72674] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versicolorin B [CHEBI:72674] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   versicolorin B [CHEBI:72674] (1)  acetal [CHEBI:59769] (62)   cyclic acetal [CHEBI:59770] (28)   versicolorin B [CHEBI:72674] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   versicolorin B [CHEBI:72674] (1)  acetal [CHEBI:59769] (62)   cyclic acetal [CHEBI:59770] (28)   versicolorin B [CHEBI:72674] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   versicolorin B [CHEBI:72674] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   versicolorin B [CHEBI:72674] (1)  acetal [CHEBI:59769] (62)   cyclic acetal [CHEBI:59770] (28)   versicolorin B [CHEBI:72674] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versicolorin B [CHEBI:72674] (1)  quinone [CHEBI:36141] (209)   versicolorin B [CHEBI:72674] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   versicolorin B [CHEBI:72674] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versicolorin B [CHEBI:72674] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   versicolorin B [CHEBI:72674] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   versicolorin B [CHEBI:72674] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versicolorin B [CHEBI:72674] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   versicolorin B [CHEBI:72674] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versicolorin B [CHEBI:72674] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   versicolorin B [CHEBI:72674] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   versicolorin B [CHEBI:72674] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   versicolorin B [CHEBI:72674] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versicolorin B [CHEBI:72674] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   versicolorin B [CHEBI:72674] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   versicolorin B [CHEBI:72674] (1) ChEBI Compound Accession Identifier:   [CHEBI:72674] ChEBI Compound Description:   An organic heteropentacyclic compound that is 2,3,3a,12a-tetrahydroanthra[2,3-b]furo[3,2-d]furan-5,10-dione carrying three hydroxy substituents at positions 4, 6 and 8. ChEBI Compound Identification Number:   72674 ChEBI InChI Value:   InChI=1S/C18H12O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h3-5,7,18-20,23H,1-2H2/t7-,18+/m0/s1 ChEBI InChIKey Value:   BABJNKGTTYCTOO-ULCDLSAGSA-N ChEBI Compound Name:   versicolorin B ChEBI SMILES Value:   [H][C@]12OCC[C@@]1([H])c1c(O)c3C(=O)c4c(O)cc(O)cc4C(=O)c3cc1O2 ChEBI Substance ID:   162012134 ChEBI URL:   ChEBI:72674 ChemSpider ID:   96988 Ontomatica Chemical Accession Key (OnChAKey):   BABJNKGTTYCTOO_ULCDLSAGSA_N_000_000000 PubChem Compound ID:   107849