| more general categories | information about this item |  | 
| | 03. Biological Effects of Specific Chemicals |  |  |  |
 |
 | 03. Biological Effects of Specific Chemicals |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  | 
| | 08. Chemical Category |  |  |  |
 |
 | 08. Chemical Category |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | 2,3-dinor-prostaglandin E2 [CHEBI:73952] (1) |  | 
|  | 
| ChEBI Compound Accession Identifier: | [CHEBI:73952] | 
| ChEBI Compound Description: | A prostanoid that is prostaglandin E2 lacking two methylenes in the carboxyalkyl chain. | 
| ChEBI Compound Identification Number: | 73952 | 
| ChEBI InChI Value: | InChI=1S/C18H28O5/c1-2-3-4-7-13(19)10-11-15-14(16(20)12-17(15)21)8-5-6-9-18(22)23/h5-6,10-11,13-15,17,19,21H,2-4,7-9,12H2,1H3,(H,22,23)/b6-5-,11-10+/t13-,14+,15+,17+/m0/s1 | 
| ChEBI InChIKey Value: | KEULKCWSUHLQGJ-ZRXREZFBSA-N | 
| ChEBI Compound Name: | 2,3-dinor-prostaglandin E2 | 
| ChEBI SMILES Value: | CCCCC[C@H](O)\\C=C\\[C@H]1[C@H](O)CC(=O)[C@@H]1C\\C=C/CC(O)=O | 
| ChEBI Substance ID: | 163626842 | 
| ChEBI URL: | ChEBI:73952 | 
| ChemSpider ID: | NS | 
| Ontomatica Chemical Accession Key (OnChAKey): | KEULKCWSUHLQGJ_ZRXREZFBSA_N_000_000000 | 
| PubChem Compound ID: | 52921876 |