New Search

Item 1 of 1 (back to results)

3-aminoisobutyric acid
A beta-amino-acid that is isobutyric acid in which one of the methyl hydrogens is substituted by an amino group.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > 3-aminoisobutyric acid [CHEBI:27389]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 3-aminoisobutyric acid [CHEBI:27389] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 beta-amino acid [CHEBI:33706] (23) 
 3-aminoisobutyric acid [CHEBI:27389] (3)
ChEBI Compound Accession Identifier  [CHEBI:27389]
ChEBI Compound Description  A beta-amino-acid that is isobutyric acid in which one of the methyl hydrogens is substituted by an amino group.
ChEBI Compound Identification Number  27389
ChEBI InChI Value  InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)
ChEBI InChIKey Value  QCHPKSFMDHPSNR-UHFFFAOYSA-N
ChEBI Compound Name  3-aminoisobutyric acid
ChEBI SMILES Value  CC(CN)C(O)=O
ChEBI Substance ID  49693464
ChEBI URL  ChEBI:27389
ChemSpider ID  58481
Ontomatica Chemical Accession Key (OnChAKey)  QCHPKSFMDHPSNR_UHFFFAOYSA_N_000_000000
PubChem Compound ID  64956