| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
|
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
|
|
5beta-cholestane-3alpha,7alpha,24,26-tetrol [CHEBI:48731] (2) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:48731] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
48731 |
| ChEBI InChI Value: |
InChI=1S/C27H48O4/c1-16(5-8-23(30)17(2)15-28)20-6-7-21-25-22(10-12-27(20,21)4)26(3)11-9-19(29)13-18(26)14-24(25)31/h16-25,28-31H,5-15H2,1-4H3/t16-,17?,18+,19-,20-,21+,22+,23?,24-,25+,26+,27-/m1/s1 |
| ChEBI InChIKey Value: |
KOHAQNVGTABZFS-ZUMVMERMSA-N |
| ChEBI Compound Name: |
5beta-cholestane-3alpha,7alpha,24,26-tetrol |
| ChEBI SMILES Value: |
[H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)[C@]([H])(CC[C@@]3([H])[C@]1([H])[C@H](O)C2)[C@H](C)CCC(O)C(C)CO |
| ChEBI Substance ID: |
49658894 |
| ChEBI URL: |
ChEBI:48731 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
KOHAQNVGTABZFS_ZUMVMERMSA_N_000_000000 |
| PubChem Compound ID: |
5284199 |