Item 1 of 1 (back to results) descarbamoylnovobiocin A hydroxycoumarin that is novobiocin lacking the carbamoyl group from position 3 on the hexose ring.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > descarbamoylnovobiocin [CHEBI:31467] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   descarbamoylnovobiocin [CHEBI:31467] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   descarbamoylnovobiocin [CHEBI:31467] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   descarbamoylnovobiocin [CHEBI:31467] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   descarbamoylnovobiocin [CHEBI:31467] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   hexoside [CHEBI:35313] (246)   descarbamoylnovobiocin [CHEBI:31467] (1)  carbohydrate derivative [CHEBI:63299] (2582)   monosaccharide derivative [CHEBI:63367] (720)   descarbamoylnovobiocin [CHEBI:31467] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   descarbamoylnovobiocin [CHEBI:31467] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   hexoside [CHEBI:35313] (246)   descarbamoylnovobiocin [CHEBI:31467] (1)  carbohydrate derivative [CHEBI:63299] (2582)   monosaccharide derivative [CHEBI:63367] (720)   descarbamoylnovobiocin [CHEBI:31467] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   descarbamoylnovobiocin [CHEBI:31467] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   descarbamoylnovobiocin [CHEBI:31467] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   hexoside [CHEBI:35313] (246)   descarbamoylnovobiocin [CHEBI:31467] (1)  carbohydrate derivative [CHEBI:63299] (2582)   monosaccharide derivative [CHEBI:63367] (720)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   descarbamoylnovobiocin [CHEBI:31467] (1) ChEBI Compound Accession Identifier:   [CHEBI:31467] ChEBI Compound Description:   A hydroxycoumarin that is novobiocin lacking the carbamoyl group from position 3 on the hexose ring. ChEBI Compound Identification Number:   31467 ChEBI InChI Value:   InChI=1S/C30H35NO10/c1-14(2)7-8-16-13-17(9-11-19(16)32)27(36)31-21-22(33)18-10-12-20(15(3)25(18)40-28(21)37)39-29-24(35)23(34)26(38-6)30(4,5)41-29/h7,9-13,23-24,26,29,32-35H,8H2,1-6H3,(H,31,36)/t23-,24+,26+,29+/m0/s1 ChEBI InChIKey Value:   UZHGFJZFJRMSOS-NANZAVOOSA-N ChEBI Compound Name:   descarbamoylnovobiocin ChEBI SMILES Value:   CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2C)OC1(C)C ChEBI Substance ID:   163626653 ChEBI URL:   ChEBI:31467 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   UZHGFJZFJRMSOS_NANZAVOOSA_N_000_000000 PubChem Compound ID:   54691350