New Search

Item 1 of 1 (back to results)

novobiocic acid
A hydroxycoumarin that is the aglycone of novobiocin.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > novobiocic acid [CHEBI:31923]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 novobiocic acid [CHEBI:31923] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 novobiocic acid [CHEBI:31923] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 novobiocic acid [CHEBI:31923] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 novobiocic acid [CHEBI:31923] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 novobiocic acid [CHEBI:31923] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 novobiocic acid [CHEBI:31923] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 novobiocic acid [CHEBI:31923] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 novobiocic acid [CHEBI:31923] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 novobiocic acid [CHEBI:31923] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 novobiocic acid [CHEBI:31923] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 novobiocic acid [CHEBI:31923] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 novobiocic acid [CHEBI:31923] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 novobiocic acid [CHEBI:31923] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 novobiocic acid [CHEBI:31923] (1)
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 novobiocic acid [CHEBI:31923] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 novobiocic acid [CHEBI:31923] (1)
ChEBI Compound Accession Identifier  [CHEBI:31923]
ChEBI Compound Description  A hydroxycoumarin that is the aglycone of novobiocin.
ChEBI Compound Identification Number  31923
ChEBI InChI Value  InChI=1S/C22H21NO6/c1-11(2)4-5-13-10-14(6-8-17(13)25)21(27)23-18-19(26)15-7-9-16(24)12(3)20(15)29-22(18)28/h4,6-10,24-26H,5H2,1-3H3,(H,23,27)
ChEBI InChIKey Value  NMCFFEJWADWZTI-UHFFFAOYSA-N
ChEBI Compound Name  novobiocic acid
ChEBI SMILES Value  CC(C)=CCc1cc(ccc1O)C(=O)Nc1c(O)c2ccc(O)c(C)c2oc1=O
ChEBI Substance ID  163626655
ChEBI URL  ChEBI:31923
ChemSpider ID  20118160
Ontomatica Chemical Accession Key (OnChAKey)  NMCFFEJWADWZTI_UHFFFAOYSA_N_000_000000
PubChem Compound ID  54691348