| more general categories | information about this item |  | 
| | 03. Biological Effects of Specific Chemicals |  |  |  |
 |
 | 03. Biological Effects of Specific Chemicals |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  | 
| | 08. Chemical Category |  |  |  |
 |
 | 08. Chemical Category |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | gammaGluCys(IAN)Gly [CHEBI:64980] (1) |  | 
|  | 
| ChEBI Compound Accession Identifier: | [CHEBI:64980] | 
| ChEBI Compound Description: | A glutathione conjugate that is the S-cyano(indol-3-yl)methyl derivative of glutathione. | 
| ChEBI Compound Identification Number: | 64980 | 
| ChEBI InChI Value: | InChI=1S/C20H23N5O6S/c21-7-16(12-8-23-14-4-2-1-3-11(12)14)32-10-15(19(29)24-9-18(27)28)25-17(26)6-5-13(22)20(30)31/h1-4,8,13,15-16,23H,5-6,9-10,22H2,(H,24,29)(H,25,26)(H,27,28)(H,30,31)/t13-,15-,16?/m0/s1 | 
| ChEBI InChIKey Value: | IYKWLNJKMRZQJG-JFXOEICMSA-N | 
| ChEBI Compound Name: | gammaGluCys(IAN)Gly | 
| ChEBI SMILES Value: | N[C@@H](CCC(=O)N[C@@H](CSC(C#N)c1c[nH]c2ccccc12)C(=O)NCC(O)=O)C(O)=O | 
| ChEBI Substance ID: | 160962795 | 
| ChEBI URL: | ChEBI:64980 | 
| ChemSpider ID: | NS | 
| Ontomatica Chemical Accession Key (OnChAKey): | IYKWLNJKMRZQJG_JFXOEICMSA_N_000_000000 | 
| PubChem Compound ID: | 70788955 |