Item 1 of 1 (back to results) D-glucosyl indole-3-carboxylate An O-acyl carbohydrate obtained by formal condensation of the carboxy group of indole-3-carboxylic acid with the anomeric hydroxy group of D-glucose.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > D-glucosyl indole-3-carboxylate [CHEBI:65021] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   hexoside [CHEBI:35313] (246)   glucoside [CHEBI:24278] (206)   D-glucoside [CHEBI:35436] (202)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  carbohydrate derivative [CHEBI:63299] (2582)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  O-acyl carbohydrate [CHEBI:52782] (25)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   hexoside [CHEBI:35313] (246)   glucoside [CHEBI:24278] (206)   D-glucoside [CHEBI:35436] (202)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  carbohydrate derivative [CHEBI:63299] (2582)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  O-acyl carbohydrate [CHEBI:52782] (25)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   hexoside [CHEBI:35313] (246)   glucoside [CHEBI:24278] (206)   D-glucoside [CHEBI:35436] (202)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  carbohydrate derivative [CHEBI:63299] (2582)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  O-acyl carbohydrate [CHEBI:52782] (25)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   D-glucosyl indole-3-carboxylate [CHEBI:65021] (1) ChEBI Compound Accession Identifier:   [CHEBI:65021] ChEBI Compound Description:   An O-acyl carbohydrate obtained by formal condensation of the carboxy group of indole-3-carboxylic acid with the anomeric hydroxy group of D-glucose. ChEBI Compound Identification Number:   65021 ChEBI InChI Value:   InChI=1S/C15H17NO7/c17-6-10-11(18)12(19)13(20)15(22-10)23-14(21)8-5-16-9-4-2-1-3-7(8)9/h1-5,10-13,15-20H,6H2/t10-,11-,12+,13-,15?/m1/s1 ChEBI InChIKey Value:   OQZPHKHJQADXAS-CKMVWSRUSA-N ChEBI Compound Name:   D-glucosyl indole-3-carboxylate ChEBI SMILES Value:   OC[C@H]1OC(OC(=O)c2c[nH]c3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O ChEBI Substance ID:   160644763 ChEBI URL:   ChEBI:65021 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   OQZPHKHJQADXAS_CKMVWSRUSA_N_000_000000 PubChem Compound ID:   66655952