Item 1 of 1 (back to results) gammaGluCys(IAN) An S-conjugate dipeptide consisting of L-gamma-glutamyl-L-cysteine in which the the cysteine side chain is substituted by a cyano(indol-3-yl)methyl group.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > gammaGluCys(IAN) [CHEBI:65022] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   gammaGluCys(IAN) [CHEBI:65022] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   gammaGluCys(IAN) [CHEBI:65022] (1)  organonitrogen compound [CHEBI:35352] (6705)   cyanides [CHEBI:23424] (120)   nitrile [CHEBI:18379] (117)   gammaGluCys(IAN) [CHEBI:65022] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   gammaGluCys(IAN) [CHEBI:65022] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   gammaGluCys(IAN) [CHEBI:65022] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   gammaGluCys(IAN) [CHEBI:65022] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   gammaGluCys(IAN) [CHEBI:65022] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organonitrogen compound [CHEBI:35352] (6705)   cyanides [CHEBI:23424] (120)   nitrile [CHEBI:18379] (117)   gammaGluCys(IAN) [CHEBI:65022] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   gammaGluCys(IAN) [CHEBI:65022] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   gammaGluCys(IAN) [CHEBI:65022] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   gammaGluCys(IAN) [CHEBI:65022] (1)  bioconjugate [CHEBI:64985] (6)   S-conjugate [CHEBI:64987] (4)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   gammaGluCys(IAN) [CHEBI:65022] (1) ChEBI Compound Accession Identifier:   [CHEBI:65022] ChEBI Compound Description:   An S-conjugate dipeptide consisting of L-gamma-glutamyl-L-cysteine in which the the cysteine side chain is substituted by a cyano(indol-3-yl)methyl group. ChEBI Compound Identification Number:   65022 ChEBI InChI Value:   InChI=1S/C18H20N4O5S/c19-7-15(11-8-21-13-4-2-1-3-10(11)13)28-9-14(18(26)27)22-16(23)6-5-12(20)17(24)25/h1-4,8,12,14-15,21H,5-6,9,20H2,(H,22,23)(H,24,25)(H,26,27)/t12-,14-,15?/m0/s1 ChEBI InChIKey Value:   FGSKBDHSKRORJJ-XRJCJLGXSA-N ChEBI Compound Name:   gammaGluCys(IAN) ChEBI SMILES Value:   N[C@@H](CCC(=O)N[C@@H](CSC(C#N)c1c[nH]c2ccccc12)C(O)=O)C(O)=O ChEBI Substance ID:   160644972 ChEBI URL:   ChEBI:65022 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   FGSKBDHSKRORJJ_XRJCJLGXSA_N_000_000000 PubChem Compound ID:   70678683