Item 1 of 1 (back to results) 1-methyltryptophan A methyltryptophan that is tryptophan carrying a single methyl substituent at position 1 on the indole.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > indoleamine 2,3-dioxygenase inhibitor [CHEBI:72854] > 1-methyltryptophan [CHEBI:72821] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   indoleamine 2,3-dioxygenase inhibitor [CHEBI:72854] (1)   1-methyltryptophan [CHEBI:72821] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   1-methyltryptophan [CHEBI:72821] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   tryptophan derivative [CHEBI:27164] (31)   methyltryptophan [CHEBI:72851] (5)   1-methyltryptophan [CHEBI:72821] (1) ChEBI Compound Accession Identifier:   [CHEBI:72821] ChEBI Compound Description:   A methyltryptophan that is tryptophan carrying a single methyl substituent at position 1 on the indole. ChEBI Compound Identification Number:   72821 ChEBI InChI Value:   InChI=1S/C12H14N2O2/c1-14-7-8(6-10(13)12(15)16)9-4-2-3-5-11(9)14/h2-5,7,10H,6,13H2,1H3,(H,15,16) ChEBI InChIKey Value:   ZADWXFSZEAPBJS-UHFFFAOYSA-N ChEBI Compound Name:   1-methyltryptophan ChEBI SMILES Value:   Cn1cc(CC(N)C(O)=O)c2ccccc12 ChEBI Substance ID:   162012198 ChEBI URL:   ChEBI:72821 ChemSpider ID:   88584 Ontomatica Chemical Accession Key (OnChAKey):   ZADWXFSZEAPBJS_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   98112