| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
|
|
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
| 08. Chemical Category |
|
|
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,6-dichloroisonicotinic acid [CHEBI:73179] (1) |
|
|
| ChEBI Compound Accession Identifier: |
[CHEBI:73179] |
| ChEBI Compound Description: |
A member of the class of pyridines that is isonicotinic acid which is substituted by chlorine at positions 2 and 6. |
| ChEBI Compound Identification Number: |
73179 |
| ChEBI InChI Value: |
InChI=1S/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2H,(H,10,11) |
| ChEBI InChIKey Value: |
SQSYNRCXIZHKAI-UHFFFAOYSA-N |
| ChEBI Compound Name: |
2,6-dichloroisonicotinic acid |
| ChEBI SMILES Value: |
OC(=O)c1cc(Cl)nc(Cl)c1 |
| ChEBI Substance ID: |
162169339 |
| ChEBI URL: |
ChEBI:73179 |
| ChemSpider ID: |
85563 |
| Ontomatica Chemical Accession Key (OnChAKey): |
SQSYNRCXIZHKAI_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
94830 |