Item 1 of 1 (back to results) batzelladine B A carboxylic ester obtained by the formal condensation of (2aR,7R,8aS)-7-heptyl-4-methyl-2,2a,6,7,8,8a-hexahydro-1H-5,6,8b-triazaacenaphthylene-3-carboxylic acid with the hydroxy group of 4-carbamimidamidobutyl 3-(9-hydroxynonyl)-1-imino-1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine-4-carboxylate. Isolated from a bright red Caribbean sponge, Batzella, it has potential anti-HIV activity.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > batzelladine B [CHEBI:65467] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   batzelladine B [CHEBI:65467] (1)  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   anti-HIV agent [CHEBI:64946] (126)   anti-HIV-1 agent [CHEBI:64947] (79)   batzelladine B [CHEBI:65467] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   batzelladine B [CHEBI:65467] (1)  guanidines [CHEBI:24436] (80)   batzelladine B [CHEBI:65467] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   batzelladine B [CHEBI:65467] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   batzelladine B [CHEBI:65467] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic heterobicyclic compound [CHEBI:27171] (1315)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   batzelladine B [CHEBI:65467] (1)  guanidines [CHEBI:24436] (80)   batzelladine B [CHEBI:65467] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   batzelladine B [CHEBI:65467] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   batzelladine B [CHEBI:65467] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic heterobicyclic compound [CHEBI:27171] (1315)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   batzelladine B [CHEBI:65467] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic heterobicyclic compound [CHEBI:27171] (1315)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic heterobicyclic compound [CHEBI:27171] (1315)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic heterobicyclic compound [CHEBI:27171] (1315)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic heterobicyclic compound [CHEBI:27171] (1315)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic heterobicyclic compound [CHEBI:27171] (1315)   pyrrolopyrimidine [CHEBI:38670] (14)   batzelladine B [CHEBI:65467] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   batzelladine B [CHEBI:65467] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   batzelladine B [CHEBI:65467] (1) ChEBI Compound Accession Identifier:   [CHEBI:65467] ChEBI Compound Description:   A carboxylic ester obtained by the formal condensation of (2aR,7R,8aS)-7-heptyl-4-methyl-2,2a,6,7,8,8a-hexahydro-1H-5,6,8b-triazaacenaphthylene-3-carboxylic acid with the hydroxy group of 4-carbamimidamidobutyl 3-(9-hydroxynonyl)-1-imino-1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine-4-carboxylate. Isolated from a bright red Caribbean sponge, Batzella, it has potential anti-HIV activity. ChEBI Compound Identification Number:   65467 ChEBI InChI Value:   InChI=1S/C40H67N9O4/c1-3-4-5-9-12-18-29-27-30-21-22-33-34(28(2)45-40(46-29)49(30)33)36(50)52-25-15-11-8-6-7-10-13-19-31-35(32-20-17-24-48(32)39(43)47-31)37(51)53-26-16-14-23-44-38(41)42/h29-31,33H,3-27H2,1-2H3,(H2,43,47)(H,45,46)(H4,41,42,44)/t29-,30+,31?,33-/m1/s1 ChEBI InChIKey Value:   CFRXQGXKLCOKGG-BNKKYZKKSA-N ChEBI Compound Name:   batzelladine B ChEBI SMILES Value:   [H][C@@]12CC[C@@]3([H])N1C(N[C@H](CCCCCCC)C2)=NC(C)=C3C(=O)OCCCCCCCCCC1NC(=N)N2CCCC2=C1C(=O)OCCCCNC(N)=N ChEBI Substance ID:   160645175 ChEBI URL:   ChEBI:65467 ChemSpider ID:   8094048 Ontomatica Chemical Accession Key (OnChAKey):   CFRXQGXKLCOKGG_BNKKYZKKSA_N_000_000000 PubChem Compound ID:   9918402