Item 1 of 1 (back to results) benthophoenin A member of the class of phenazines that is 5,10-dihydrophenazine-1-carboxylic acid substituted by benzoyl groups at positions 3 and 7 and a geranyl moiety at position 5. It is isolated from the mycelium of Streptomyces prunicolor and acts as a free radical scavenger.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > benthophoenin [CHEBI:65482] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   benthophoenin [CHEBI:65482] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Archaea, Cyanobacteria and Bacteria (302)   Eubacteria (239)   Firmicutes (214)   Actinobacteria (204)   Actinobacteridae (204)   Actinomycetales (204)   Streptomycetaceae (160)   Streptomyces (157)   Streptomyces prunicolor (1) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  fungal structure [FS:0000000] (133)   mycelium [FS:0000000] (126) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   diketone [CHEBI:46640] (53)   benthophoenin [CHEBI:65482] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   diketone [CHEBI:46640] (53)   benthophoenin [CHEBI:65482] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   diketone [CHEBI:46640] (53)   benthophoenin [CHEBI:65482] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   diketone [CHEBI:46640] (53)   benthophoenin [CHEBI:65482] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenazines [CHEBI:39201] (13)   benthophoenin [CHEBI:65482] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   diketone [CHEBI:46640] (53)   benthophoenin [CHEBI:65482] (1)  carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   dioxo monocarboxylic acid [CHEBI:35951] (21)   benthophoenin [CHEBI:65482] (1) 09. Chemical Capabilities  09. Chemical Capabilities  antioxidant [CHEBI:22586] (199)   radical scavenger [CHEBI:48578] (62)   benthophoenin [CHEBI:65482] (1) ChEBI Compound Accession Identifier:   [CHEBI:65482] ChEBI Compound Description:   A member of the class of phenazines that is 5,10-dihydrophenazine-1-carboxylic acid substituted by benzoyl groups at positions 3 and 7 and a geranyl moiety at position 5. It is isolated from the mycelium of Streptomyces prunicolor and acts as a free radical scavenger. ChEBI Compound Identification Number:   65482 ChEBI InChI Value:   InChI=1S/C37H34N2O4/c1-24(2)11-10-12-25(3)19-20-39-32-22-28(35(40)26-13-6-4-7-14-26)17-18-31(32)38-34-30(37(42)43)21-29(23-33(34)39)36(41)27-15-8-5-9-16-27/h4-9,11,13-19,21-23,38H,10,12,20H2,1-3H3,(H,42,43)/b25-19+ ChEBI InChIKey Value:   ZXEFSITWOFAFSF-NCELDCMTSA-N ChEBI Compound Name:   benthophoenin ChEBI SMILES Value:   CC(C)=CCC\C(C)=C\CN1c2cc(ccc2Nc2c1cc(cc2C(O)=O)C(=O)c1ccccc1)C(=O)c1ccccc1 ChEBI Substance ID:   160644885 ChEBI URL:   ChEBI:65482 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   ZXEFSITWOFAFSF_NCELDCMTSA_N_000_000000 PubChem Compound ID:   44584441