Item 1 of 1 (back to results) bidenlignaside B A neolignan isolated from the whole plant of Bidens parviflora that has been found to inhibit histamine release from the peritoneal exudate mast cells induced by antigen-antibody reaction.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > bidenlignaside B [CHEBI:65495] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   bidenlignaside B [CHEBI:65495] (1)  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   histaminergic drug [CHEBI:37957] (94)   histamine antagonist [CHEBI:37956] (87)   bidenlignaside B [CHEBI:65495] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   diol [CHEBI:23824] (172)   bidenlignaside B [CHEBI:65495] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   bidenlignaside B [CHEBI:65495] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   bidenlignaside B [CHEBI:65495] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   diol [CHEBI:23824] (172)   bidenlignaside B [CHEBI:65495] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   bidenlignaside B [CHEBI:65495] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   bidenlignaside B [CHEBI:65495] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   bidenlignaside B [CHEBI:65495] (1)  glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   hexoside [CHEBI:35313] (246)   glucoside [CHEBI:24278] (206)   D-glucoside [CHEBI:35436] (202)   beta-D-glucoside [CHEBI:10400] (171)   bidenlignaside B [CHEBI:65495] (1)  beta-glucoside [CHEBI:60980] (171)   beta-D-glucoside [CHEBI:10400] (171)   bidenlignaside B [CHEBI:65495] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   bidenlignaside B [CHEBI:65495] (1)  glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   hexoside [CHEBI:35313] (246)   glucoside [CHEBI:24278] (206)   D-glucoside [CHEBI:35436] (202)   beta-D-glucoside [CHEBI:10400] (171)   bidenlignaside B [CHEBI:65495] (1)  beta-glucoside [CHEBI:60980] (171)   beta-D-glucoside [CHEBI:10400] (171)   bidenlignaside B [CHEBI:65495] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   bidenlignaside B [CHEBI:65495] (1)  glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   hexoside [CHEBI:35313] (246)   glucoside [CHEBI:24278] (206)   D-glucoside [CHEBI:35436] (202)   beta-D-glucoside [CHEBI:10400] (171)   bidenlignaside B [CHEBI:65495] (1)  beta-glucoside [CHEBI:60980] (171)   beta-D-glucoside [CHEBI:10400] (171)   bidenlignaside B [CHEBI:65495] (1)  organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   diol [CHEBI:23824] (172)   bidenlignaside B [CHEBI:65495] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   bidenlignaside B [CHEBI:65495] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   bidenlignaside B [CHEBI:65495] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   neolignan [CHEBI:25497] (3)   bidenlignaside B [CHEBI:65495] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   bidenlignaside B [CHEBI:65495] (1)  aromatic ether [CHEBI:35618] (353)   bidenlignaside B [CHEBI:65495] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   neolignan [CHEBI:25497] (3)   bidenlignaside B [CHEBI:65495] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   bidenlignaside B [CHEBI:65495] (1)  aromatic ether [CHEBI:35618] (353)   bidenlignaside B [CHEBI:65495] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   neolignan [CHEBI:25497] (3)   bidenlignaside B [CHEBI:65495] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   bidenlignaside B [CHEBI:65495] (1)  aromatic ether [CHEBI:35618] (353)   bidenlignaside B [CHEBI:65495] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   neolignan [CHEBI:25497] (3)   bidenlignaside B [CHEBI:65495] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   bidenlignaside B [CHEBI:65495] (1)  aromatic ether [CHEBI:35618] (353)   bidenlignaside B [CHEBI:65495] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   diol [CHEBI:23824] (172)   bidenlignaside B [CHEBI:65495] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   bidenlignaside B [CHEBI:65495] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   bidenlignaside B [CHEBI:65495] (1) ChEBI Compound Accession Identifier:   [CHEBI:65495] ChEBI Compound Description:   A neolignan isolated from the whole plant of Bidens parviflora that has been found to inhibit histamine release from the peritoneal exudate mast cells induced by antigen-antibody reaction. ChEBI Compound Identification Number:   65495 ChEBI InChI Value:   InChI=1S/C26H34O12/c1-35-19-10-14(5-6-16(19)28)17(29)11-18(30)15-8-13(9-20(36-2)22(15)31)4-3-7-37-26-25(34)24(33)23(32)21(12-27)38-26/h3-6,8-10,17-18,21,23-34H,7,11-12H2,1-2H3/b4-3+/t17?,18?,21-,23-,24+,25-,26-/m1/s1 ChEBI InChIKey Value:   XSWHADNOBPLVSA-FBTMRFIHSA-N ChEBI Compound Name:   bidenlignaside B ChEBI SMILES Value:   COc1cc(ccc1O)C(O)CC(O)c1cc(\C=C\CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1O ChEBI Substance ID:   160644876 ChEBI URL:   ChEBI:65495 ChemSpider ID:   17240764 Ontomatica Chemical Accession Key (OnChAKey):   XSWHADNOBPLVSA_FBTMRFIHSA_N_000_000000 PubChem Compound ID:   16082055