Item 1 of 1 (back to results) conferol B A member of the class of isoflavans that is isoflavan with a hydroxy group at position 4, a methyl group at position 7 and a methoxy group at position 2' (the 3R,4S stereoisomer). It is isolated from Caragana conferta and exhibits significant anti-inflammatory activity in the respiratory burst assay.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > conferol B [CHEBI:65654] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   conferol B [CHEBI:65654] (1) 05. Industrial Uses  05. Industrial Uses  anti-inflammatory agent [CHEBI:67079] (79)   conferol B [CHEBI:65654] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   conferol B [CHEBI:65654] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   conferol B [CHEBI:65654] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  flavonoids [CHEBI:72544] (433)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   conferol B [CHEBI:65654] (1)  flavonoids [CHEBI:72544] (433)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   isoflavonoid [CHEBI:50753] (52)   isoflavans [CHEBI:72572] (20)   conferol B [CHEBI:65654] (1)  benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   conferol B [CHEBI:65654] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   conferol B [CHEBI:65654] (1) ChEBI Compound Accession Identifier:   [CHEBI:65654] ChEBI Compound Description:   A member of the class of isoflavans that is isoflavan with a hydroxy group at position 4, a methyl group at position 7 and a methoxy group at position 2' (the 3R,4S stereoisomer). It is isolated from Caragana conferta and exhibits significant anti-inflammatory activity in the respiratory burst assay. ChEBI Compound Identification Number:   65654 ChEBI InChI Value:   InChI=1S/C17H18O3/c1-11-7-8-13-16(9-11)20-10-14(17(13)18)12-5-3-4-6-15(12)19-2/h3-9,14,17-18H,10H2,1-2H3/t14-,17+/m0/s1 ChEBI InChIKey Value:   VQOQOBSDPFOCSL-WMLDXEAASA-N ChEBI Compound Name:   conferol B ChEBI SMILES Value:   [H][C@]1(COc2cc(C)ccc2[C@H]1O)c1ccccc1OC ChEBI Substance ID:   160655783 ChEBI URL:   ChEBI:65654 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   VQOQOBSDPFOCSL_WMLDXEAASA_N_000_000000 PubChem Compound ID:   42604345