Item 1 of 1 (back to results) curtisian B A ring assembly that consists of 1,4-diphenylbenzene substituted by acetyloxy groups at positions 3', 5' and 6', hydroxy groups at positions 4 and 4'' and a (3-phenylpropanoyl)oxy group at position 2'. It is isolated from the fruit body of the mushroom Paxillus curtisii and exhibits radical scavenging activity.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > curtisian B [CHEBI:65697] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   curtisian B [CHEBI:65697] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   curtisian B [CHEBI:65697] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   curtisian B [CHEBI:65697] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   curtisian B [CHEBI:65697] (1)  3-phenylpropionate ester [CHEBI:50791] (2)   curtisian B [CHEBI:65697] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   curtisian B [CHEBI:65697] (1)  3-phenylpropionate ester [CHEBI:50791] (2)   curtisian B [CHEBI:65697] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   curtisian B [CHEBI:65697] (1)  3-phenylpropionate ester [CHEBI:50791] (2)   curtisian B [CHEBI:65697] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   curtisian B [CHEBI:65697] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   curtisian B [CHEBI:65697] (1)  3-phenylpropionate ester [CHEBI:50791] (2)   curtisian B [CHEBI:65697] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   curtisian B [CHEBI:65697] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   curtisian B [CHEBI:65697] (1)  3-phenylpropionate ester [CHEBI:50791] (2)   curtisian B [CHEBI:65697] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   curtisian B [CHEBI:65697] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   curtisian B [CHEBI:65697] (1)  ring assembly [CHEBI:36820] (165)   curtisian B [CHEBI:65697] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   curtisian B [CHEBI:65697] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   curtisian B [CHEBI:65697] (1)  3-phenylpropionate ester [CHEBI:50791] (2)   curtisian B [CHEBI:65697] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   curtisian B [CHEBI:65697] (1) 09. Chemical Capabilities  09. Chemical Capabilities  antioxidant [CHEBI:22586] (199)   radical scavenger [CHEBI:48578] (62)   curtisian B [CHEBI:65697] (1) ChEBI Compound Accession Identifier:   [CHEBI:65697] ChEBI Compound Description:   A ring assembly that consists of 1,4-diphenylbenzene substituted by acetyloxy groups at positions 3', 5' and 6', hydroxy groups at positions 4 and 4'' and a (3-phenylpropanoyl)oxy group at position 2'. It is isolated from the fruit body of the mushroom Paxillus curtisii and exhibits radical scavenging activity. ChEBI Compound Identification Number:   65697 ChEBI InChI Value:   InChI=1S/C33H28O10/c1-19(34)40-30-28(23-10-14-25(37)15-11-23)32(42-21(3)36)33(43-27(39)18-9-22-7-5-4-6-8-22)29(31(30)41-20(2)35)24-12-16-26(38)17-13-24/h4-8,10-17,37-38H,9,18H2,1-3H3 ChEBI InChIKey Value:   FVIXJWLGXKDNER-UHFFFAOYSA-N ChEBI Compound Name:   curtisian B ChEBI SMILES Value:   CC(=O)Oc1c(OC(C)=O)c(-c2ccc(O)cc2)c(OC(=O)CCc2ccccc2)c(OC(C)=O)c1-c1ccc(O)cc1 ChEBI Substance ID:   160709496 ChEBI URL:   ChEBI:65697 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   FVIXJWLGXKDNER_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   10077008