New Search

Item 1 of 1 (back to results)

S-methyl-L-cysteine
A cysteine derivative that L-cysteine with a methyl group bound to the thiol group.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > S-methyl-L-cysteine [CHEBI:45658]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 sulfur-containing carboxylic acid [CHEBI:33576] (79) 
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 cysteine derivative [CHEBI:23509] (44) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
 sulfur-containing amino acid [CHEBI:26834] (40) 
 S-substituted L-cysteine [CHEBI:47910] (8) 
 S-organyl-L-cysteine [CHEBI:47912] (3) 
 S-hydrocarbyl-L-cysteine [CHEBI:47913] (3) 
 S-alkyl-L-cysteine [CHEBI:47915] (1) 
 S-methyl-L-cysteine [CHEBI:45658] (1)
ChEBI Compound Accession Identifier  [CHEBI:45658]
ChEBI Compound Description  A cysteine derivative that L-cysteine with a methyl group bound to the thiol group.
ChEBI Compound Identification Number  45658
ChEBI InChI Value  InChI=1S/C4H9NO2S/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1
ChEBI InChIKey Value  IDIDJDIHTAOVLG-VKHMYHEASA-N
ChEBI Compound Name  S-methyl-L-cysteine
ChEBI SMILES Value  CSC[C@H](N)C(O)=O
ChEBI Substance ID  163425650
ChEBI URL  ChEBI:45658
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  IDIDJDIHTAOVLG_VKHMYHEASA_N_000_000000
PubChem Compound ID  24417