Item 1 of 1 (back to results) S-methyl-L-cysteine A cysteine derivative that L-cysteine with a methyl group bound to the thiol group.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > S-methyl-L-cysteine [CHEBI:45658] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   S-methyl-L-cysteine [CHEBI:45658] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   sulfur-containing carboxylic acid [CHEBI:33576] (79)   sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1)  amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   cysteine derivative [CHEBI:23509] (44)   S-methyl-L-cysteine [CHEBI:45658] (1)  sulfur-containing amino acid [CHEBI:26834] (40)   S-substituted L-cysteine [CHEBI:47910] (8)   S-organyl-L-cysteine [CHEBI:47912] (3)   S-hydrocarbyl-L-cysteine [CHEBI:47913] (3)   S-alkyl-L-cysteine [CHEBI:47915] (1)   S-methyl-L-cysteine [CHEBI:45658] (1) ChEBI Compound Accession Identifier:   [CHEBI:45658] ChEBI Compound Description:   A cysteine derivative that L-cysteine with a methyl group bound to the thiol group. ChEBI Compound Identification Number:   45658 ChEBI InChI Value:   InChI=1S/C4H9NO2S/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 ChEBI InChIKey Value:   IDIDJDIHTAOVLG-VKHMYHEASA-N ChEBI Compound Name:   S-methyl-L-cysteine ChEBI SMILES Value:   CSC[C@H](N)C(O)=O ChEBI Substance ID:   163425650 ChEBI URL:   ChEBI:45658 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   IDIDJDIHTAOVLG_VKHMYHEASA_N_000_000000 PubChem Compound ID:   24417