Item 1 of 1 (back to results) 20-oxoleukotriene B4 A leukotriene that is leukotriene B4 bearing an additional oxo substituent at position 20.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > 20-oxoleukotriene B4 [CHEBI:63979] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   20-oxoleukotriene B4 [CHEBI:63979] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   hydroxyaldehyde [CHEBI:50413] (7)   20-oxoleukotriene B4 [CHEBI:63979] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   hydroxyaldehyde [CHEBI:50413] (7)   20-oxoleukotriene B4 [CHEBI:63979] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   hydroxyaldehyde [CHEBI:50413] (7)   20-oxoleukotriene B4 [CHEBI:63979] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  fatty acid derivative [CHEBI:61697] (144)   icosanoid [CHEBI:23899] (138)   leukotriene [CHEBI:25029] (17)   20-oxoleukotriene B4 [CHEBI:63979] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   hydroxyaldehyde [CHEBI:50413] (7)   20-oxoleukotriene B4 [CHEBI:63979] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   hydroxyaldehyde [CHEBI:50413] (7)   20-oxoleukotriene B4 [CHEBI:63979] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   20-oxoleukotriene B4 [CHEBI:63979] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   20-oxoleukotriene B4 [CHEBI:63979] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   20-oxoleukotriene B4 [CHEBI:63979] (1) ChEBI Compound Accession Identifier:   [CHEBI:63979] ChEBI Compound Description:   A leukotriene that is leukotriene B4 bearing an additional oxo substituent at position 20. ChEBI Compound Identification Number:   63979 ChEBI InChI Value:   InChI=1S/C20H30O5/c21-17-10-6-2-1-3-7-12-18(22)13-8-4-5-9-14-19(23)15-11-16-20(24)25/h3-5,7-9,13-14,17-19,22-23H,1-2,6,10-12,15-16H2,(H,24,25)/b5-4+,7-3-,13-8+,14-9-/t18-,19-/m1/s1 ChEBI InChIKey Value:   LVLQYGYNBVIONY-PSPARDEHSA-N ChEBI Compound Name:   20-oxoleukotriene B4 ChEBI SMILES Value:   O[C@@H](CCCC(O)=O)\C=C/C=C/C=C/[C@H](O)C\C=C/CCCCC=O ChEBI Substance ID:   135610833 ChEBI URL:   ChEBI:63979 ChemSpider ID:   4952515 Ontomatica Chemical Accession Key (OnChAKey):   LVLQYGYNBVIONY_PSPARDEHSA_N_000_000000 PubChem Compound ID:   6449839