| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
6,15-diketo,13,14-dihydroprostaglandin F1alpha [CHEBI:72595] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6,15-diketo,13,14-dihydroprostaglandin F1alpha [CHEBI:72595] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:72595] |
| ChEBI Compound Description: |
A prostaglandin Falpha that is prostaglandin F1alpha bearing keto substituents at positions 6 and 15. |
| ChEBI Compound Identification Number: |
72595 |
| ChEBI InChI Value: |
InChI=1S/C20H32O6/c1-2-3-4-7-14(21)10-11-16-17(19(24)13-18(16)23)12-15(22)8-5-6-9-20(25)26/h10-11,16-19,23-24H,2-9,12-13H2,1H3,(H,25,26)/b11-10+/t16-,17-,18-,19+/m1/s1 |
| ChEBI InChIKey Value: |
VKPWUQVGTPVEMU-QVPQFPIISA-N |
| ChEBI Compound Name: |
6,15-diketo,13,14-dihydroprostaglandin F1alpha |
| ChEBI SMILES Value: |
CCCCCC(=O)\\C=C\\[C@H]1[C@H](O)C[C@H](O)[C@@H]1CC(=O)CCCCC(O)=O |
| ChEBI Substance ID: |
162012221 |
| ChEBI URL: |
ChEBI:72595 |
| ChemSpider ID: |
4446160 |
| Ontomatica Chemical Accession Key (OnChAKey): |
VKPWUQVGTPVEMU_QVPQFPIISA_N_000_000000 |
| PubChem Compound ID: |
5283033 |