Item 1 of 1 (back to results) 12-HEPE A hydroxyicosapentaenoic acid that consists of 5Z,8Z,10E,14Z,17Z-icosapentaenoic acid bearing an additional 12-hydroxy substituent.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > 12-HEPE [CHEBI:72645] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   12-HEPE [CHEBI:72645] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   long-chain fatty acid [CHEBI:15904] (221)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   hydroxy fatty acid [CHEBI:24654] (169)   HEPE [CHEBI:72799] (4)   12-HEPE [CHEBI:72645] (1) ChEBI Compound Accession Identifier:   [CHEBI:72645] ChEBI Compound Description:   A hydroxyicosapentaenoic acid that consists of 5Z,8Z,10E,14Z,17Z-icosapentaenoic acid bearing an additional 12-hydroxy substituent. ChEBI Compound Identification Number:   72645 ChEBI InChI Value:   InChI=1S/C20H30O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h3-4,7-11,13-14,17,19,21H,2,5-6,12,15-16,18H2,1H3,(H,22,23)/b4-3-,9-7-,11-8-,13-10-,17-14+ ChEBI InChIKey Value:   MCRJLMXYVFDXLS-QGQBRVLBSA-N ChEBI Compound Name:   12-HEPE ChEBI SMILES Value:   CC\\C=C/C\\C=C/CC(O)\\C=C\\C=C/C\\C=C/CCCC(O)=O ChEBI Substance ID:   162012232 ChEBI URL:   ChEBI:72645 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   MCRJLMXYVFDXLS_QGQBRVLBSA_N_000_000000 PubChem Compound ID:   10041593