Item 1 of 1 (back to results) 3-(2,3-dihydroxyphenyl)propanoic acid "A monocarboxylic acid that is propionic acid carrying a 2,3-dihydroxyphenyl substituent at C-3; a microbial metabolite of quinoline."

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > 3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   3-(2,3-dihydroxyphenyl)propanoic acid [CHEBI:18136] (1) ChEBI Compound Accession Identifier:   [CHEBI:18136] ChEBI Compound Description:   "A monocarboxylic acid that is propionic acid carrying a 2,3-dihydroxyphenyl substituent at C-3; a microbial metabolite of quinoline." ChEBI Compound Identification Number:   18136 ChEBI InChI Value:   InChI=1S/C9H10O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-3,10,13H,4-5H2,(H,11,12) ChEBI InChIKey Value:   QZDSXQJWBGMRLU-UHFFFAOYSA-N ChEBI Compound Name:   3-(2,3-dihydroxyphenyl)propanoic acid ChEBI SMILES Value:   OC(=O)CCc1cccc(O)c1O ChEBI Substance ID:   8145181 ChEBI URL:   ChEBI:18136 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   QZDSXQJWBGMRLU_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   20